Logo Search packages:      
Sourcecode: haproxy version File versions  Download package

proto_http.c

/*
 * HTTP protocol analyzer
 *
 * Copyright 2000-2007 Willy Tarreau <w@1wt.eu>
 *
 * This program is free software; you can redistribute it and/or
 * modify it under the terms of the GNU General Public License
 * as published by the Free Software Foundation; either version
 * 2 of the License, or (at your option) any later version.
 *
 */

#include <ctype.h>
#include <errno.h>
#include <fcntl.h>
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <syslog.h>
#include <time.h>

#include <sys/socket.h>
#include <sys/stat.h>
#include <sys/types.h>

#include <common/appsession.h>
#include <common/compat.h>
#include <common/config.h>
#include <common/debug.h>
#include <common/memory.h>
#include <common/mini-clist.h>
#include <common/standard.h>
#include <common/time.h>
#include <common/uri_auth.h>
#include <common/version.h>

#include <types/acl.h>
#include <types/capture.h>
#include <types/client.h>
#include <types/global.h>
#include <types/httperr.h>
#include <types/polling.h>
#include <types/proxy.h>
#include <types/server.h>

#include <proto/acl.h>
#include <proto/backend.h>
#include <proto/buffers.h>
#include <proto/fd.h>
#include <proto/log.h>
#include <proto/hdr_idx.h>
#include <proto/proto_http.h>
#include <proto/queue.h>
#include <proto/session.h>
#include <proto/task.h>

#ifdef CONFIG_HAP_TCPSPLICE
#include <libtcpsplice.h>
#endif

#define DEBUG_PARSE_NO_SPEEDUP
#undef DEBUG_PARSE_NO_SPEEDUP

/* This is used to perform a quick jump as an alternative to a break/continue
 * instruction. The first argument is the label for normal operation, and the
 * second one is the break/continue instruction in the no_speedup mode.
 */

#ifdef DEBUG_PARSE_NO_SPEEDUP
#define QUICK_JUMP(x,y) y
#else
#define QUICK_JUMP(x,y) goto x
#endif

/* This is used by remote monitoring */
const char HTTP_200[] =
      "HTTP/1.0 200 OK\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "\r\n"
      "<html><body><h1>200 OK</h1>\nHAProxy: service ready.\n</body></html>\n";

const struct chunk http_200_chunk = {
      .str = (char *)&HTTP_200,
      .len = sizeof(HTTP_200)-1
};

const char *HTTP_302 =
      "HTTP/1.0 302 Found\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Location: "; /* not terminated since it will be concatenated with the URL */

/* same as 302 except that the browser MUST retry with the GET method */
const char *HTTP_303 =
      "HTTP/1.0 303 See Other\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Location: "; /* not terminated since it will be concatenated with the URL */

/* Warning: this one is an sprintf() fmt string, with <realm> as its only argument */
const char *HTTP_401_fmt =
      "HTTP/1.0 401 Unauthorized\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "WWW-Authenticate: Basic realm=\"%s\"\r\n"
      "\r\n"
      "<html><body><h1>401 Unauthorized</h1>\nYou need a valid user and password to access this content.\n</body></html>\n";


const int http_err_codes[HTTP_ERR_SIZE] = {
      [HTTP_ERR_400] = 400,
      [HTTP_ERR_403] = 403,
      [HTTP_ERR_408] = 408,
      [HTTP_ERR_500] = 500,
      [HTTP_ERR_502] = 502,
      [HTTP_ERR_503] = 503,
      [HTTP_ERR_504] = 504,
};

static const char *http_err_msgs[HTTP_ERR_SIZE] = {
      [HTTP_ERR_400] =
      "HTTP/1.0 400 Bad request\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "\r\n"
      "<html><body><h1>400 Bad request</h1>\nYour browser sent an invalid request.\n</body></html>\n",

      [HTTP_ERR_403] =
      "HTTP/1.0 403 Forbidden\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "\r\n"
      "<html><body><h1>403 Forbidden</h1>\nRequest forbidden by administrative rules.\n</body></html>\n",

      [HTTP_ERR_408] =
      "HTTP/1.0 408 Request Time-out\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "\r\n"
      "<html><body><h1>408 Request Time-out</h1>\nYour browser didn't send a complete request in time.\n</body></html>\n",

      [HTTP_ERR_500] =
      "HTTP/1.0 500 Server Error\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "\r\n"
      "<html><body><h1>500 Server Error</h1>\nAn internal server error occured.\n</body></html>\n",

      [HTTP_ERR_502] =
      "HTTP/1.0 502 Bad Gateway\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "\r\n"
      "<html><body><h1>502 Bad Gateway</h1>\nThe server returned an invalid or incomplete response.\n</body></html>\n",

      [HTTP_ERR_503] =
      "HTTP/1.0 503 Service Unavailable\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "\r\n"
      "<html><body><h1>503 Service Unavailable</h1>\nNo server is available to handle this request.\n</body></html>\n",

      [HTTP_ERR_504] =
      "HTTP/1.0 504 Gateway Time-out\r\n"
      "Cache-Control: no-cache\r\n"
      "Connection: close\r\n"
      "Content-Type: text/html\r\n"
      "\r\n"
      "<html><body><h1>504 Gateway Time-out</h1>\nThe server didn't respond in time.\n</body></html>\n",

};

/* We must put the messages here since GCC cannot initialize consts depending
 * on strlen().
 */
struct chunk http_err_chunks[HTTP_ERR_SIZE];

#define FD_SETS_ARE_BITFIELDS
#ifdef FD_SETS_ARE_BITFIELDS
/*
 * This map is used with all the FD_* macros to check whether a particular bit
 * is set or not. Each bit represents an ACSII code. FD_SET() sets those bytes
 * which should be encoded. When FD_ISSET() returns non-zero, it means that the
 * byte should be encoded. Be careful to always pass bytes from 0 to 255
 * exclusively to the macros.
 */
fd_set hdr_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];
fd_set url_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];

#else
#error "Check if your OS uses bitfields for fd_sets"
#endif

void init_proto_http()
{
      int i;
      char *tmp;
      int msg;

      for (msg = 0; msg < HTTP_ERR_SIZE; msg++) {
            if (!http_err_msgs[msg]) {
                  Alert("Internal error: no message defined for HTTP return code %d. Aborting.\n", msg);
                  abort();
            }

            http_err_chunks[msg].str = (char *)http_err_msgs[msg];
            http_err_chunks[msg].len = strlen(http_err_msgs[msg]);
      }

      /* initialize the log header encoding map : '{|}"#' should be encoded with
       * '#' as prefix, as well as non-printable characters ( <32 or >= 127 ).
       * URL encoding only requires '"', '#' to be encoded as well as non-
       * printable characters above.
       */
      memset(hdr_encode_map, 0, sizeof(hdr_encode_map));
      memset(url_encode_map, 0, sizeof(url_encode_map));
      for (i = 0; i < 32; i++) {
            FD_SET(i, hdr_encode_map);
            FD_SET(i, url_encode_map);
      }
      for (i = 127; i < 256; i++) {
            FD_SET(i, hdr_encode_map);
            FD_SET(i, url_encode_map);
      }

      tmp = "\"#{|}";
      while (*tmp) {
            FD_SET(*tmp, hdr_encode_map);
            tmp++;
      }

      tmp = "\"#";
      while (*tmp) {
            FD_SET(*tmp, url_encode_map);
            tmp++;
      }

      /* memory allocations */
      pool2_requri = create_pool("requri", REQURI_LEN, MEM_F_SHARED);
      pool2_capture = create_pool("capture", CAPTURE_LEN, MEM_F_SHARED);
}

/*
 * We have 26 list of methods (1 per first letter), each of which can have
 * up to 3 entries (2 valid, 1 null).
 */
struct http_method_desc {
      http_meth_t meth;
      int len;
      const char text[8];
};

const struct http_method_desc http_methods[26][3] = {
      ['C' - 'A'] = {
            [0] = {     .meth = HTTP_METH_CONNECT , .len=7, .text="CONNECT" },
      },
      ['D' - 'A'] = {
            [0] = {     .meth = HTTP_METH_DELETE  , .len=6, .text="DELETE"  },
      },
      ['G' - 'A'] = {
            [0] = {     .meth = HTTP_METH_GET     , .len=3, .text="GET"     },
      },
      ['H' - 'A'] = {
            [0] = {     .meth = HTTP_METH_HEAD    , .len=4, .text="HEAD"    },
      },
      ['P' - 'A'] = {
            [0] = {     .meth = HTTP_METH_POST    , .len=4, .text="POST"    },
            [1] = {     .meth = HTTP_METH_PUT     , .len=3, .text="PUT"     },
      },
      ['T' - 'A'] = {
            [0] = {     .meth = HTTP_METH_TRACE   , .len=5, .text="TRACE"   },
      },
      /* rest is empty like this :
       *      [1] = {   .meth = HTTP_METH_NONE    , .len=0, .text=""        },
       */
};

/* It is about twice as fast on recent architectures to lookup a byte in a
 * table than two perform a boolean AND or OR between two tests. Refer to
 * RFC2616 for those chars.
 */

const char http_is_spht[256] = {
      [' '] = 1, ['\t'] = 1,
};

const char http_is_crlf[256] = {
      ['\r'] = 1, ['\n'] = 1,
};

const char http_is_lws[256] = {
      [' '] = 1, ['\t'] = 1,
      ['\r'] = 1, ['\n'] = 1,
};

const char http_is_sep[256] = {
      ['('] = 1, [')']  = 1, ['<']  = 1, ['>'] = 1,
      ['@'] = 1, [',']  = 1, [';']  = 1, [':'] = 1,
      ['"'] = 1, ['/']  = 1, ['[']  = 1, [']'] = 1,
      ['{'] = 1, ['}']  = 1, ['?']  = 1, ['='] = 1,
      [' '] = 1, ['\t'] = 1, ['\\'] = 1,
};

const char http_is_ctl[256] = {
      [0 ... 31] = 1,
      [127] = 1,
};

/*
 * A token is any ASCII char that is neither a separator nor a CTL char.
 * Do not overwrite values in assignment since gcc-2.95 will not handle
 * them correctly. Instead, define every non-CTL char's status.
 */
const char http_is_token[256] = {
      [' '] = 0, ['!'] = 1, ['"'] = 0, ['#'] = 1,
      ['$'] = 1, ['%'] = 1, ['&'] = 1, ['\''] = 1,
      ['('] = 0, [')'] = 0, ['*'] = 1, ['+'] = 1,
      [','] = 0, ['-'] = 1, ['.'] = 1, ['/'] = 0,
      ['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1,
      ['4'] = 1, ['5'] = 1, ['6'] = 1, ['7'] = 1,
      ['8'] = 1, ['9'] = 1, [':'] = 0, [';'] = 0,
      ['<'] = 0, ['='] = 0, ['>'] = 0, ['?'] = 0,
      ['@'] = 0, ['A'] = 1, ['B'] = 1, ['C'] = 1,
      ['D'] = 1, ['E'] = 1, ['F'] = 1, ['G'] = 1,
      ['H'] = 1, ['I'] = 1, ['J'] = 1, ['K'] = 1,
      ['L'] = 1, ['M'] = 1, ['N'] = 1, ['O'] = 1,
      ['P'] = 1, ['Q'] = 1, ['R'] = 1, ['S'] = 1,
      ['T'] = 1, ['U'] = 1, ['V'] = 1, ['W'] = 1,
      ['X'] = 1, ['Y'] = 1, ['Z'] = 1, ['['] = 0,
      ['\\'] = 0, [']'] = 0, ['^'] = 1, ['_'] = 1,
      ['`'] = 1, ['a'] = 1, ['b'] = 1, ['c'] = 1,
      ['d'] = 1, ['e'] = 1, ['f'] = 1, ['g'] = 1,
      ['h'] = 1, ['i'] = 1, ['j'] = 1, ['k'] = 1,
      ['l'] = 1, ['m'] = 1, ['n'] = 1, ['o'] = 1,
      ['p'] = 1, ['q'] = 1, ['r'] = 1, ['s'] = 1,
      ['t'] = 1, ['u'] = 1, ['v'] = 1, ['w'] = 1,
      ['x'] = 1, ['y'] = 1, ['z'] = 1, ['{'] = 0,
      ['|'] = 1, ['}'] = 0, ['~'] = 1, 
};


/*
 * An http ver_token is any ASCII which can be found in an HTTP version,
 * which includes 'H', 'T', 'P', '/', '.' and any digit.
 */
const char http_is_ver_token[256] = {
      ['.'] = 1, ['/'] = 1,
      ['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1, ['4'] = 1,
      ['5'] = 1, ['6'] = 1, ['7'] = 1, ['8'] = 1, ['9'] = 1,
      ['H'] = 1, ['P'] = 1, ['T'] = 1,
};


#ifdef DEBUG_FULL
static char *cli_stnames[5] = {"HDR", "DAT", "SHR", "SHW", "CLS" };
static char *srv_stnames[7] = {"IDL", "CON", "HDR", "DAT", "SHR", "SHW", "CLS" };
#endif

static void http_sess_log(struct session *s);

/*
 * Adds a header and its CRLF at the tail of buffer <b>, just before the last
 * CRLF. Text length is measured first, so it cannot be NULL.
 * The header is also automatically added to the index <hdr_idx>, and the end
 * of headers is automatically adjusted. The number of bytes added is returned
 * on success, otherwise <0 is returned indicating an error.
 */
int http_header_add_tail(struct buffer *b, struct http_msg *msg,
                   struct hdr_idx *hdr_idx, const char *text)
{
      int bytes, len;

      len = strlen(text);
      bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
      if (!bytes)
            return -1;
      msg->eoh += bytes;
      return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
}

/*
 * Adds a header and its CRLF at the tail of buffer <b>, just before the last
 * CRLF. <len> bytes are copied, not counting the CRLF. If <text> is NULL, then
 * the buffer is only opened and the space reserved, but nothing is copied.
 * The header is also automatically added to the index <hdr_idx>, and the end
 * of headers is automatically adjusted. The number of bytes added is returned
 * on success, otherwise <0 is returned indicating an error.
 */
int http_header_add_tail2(struct buffer *b, struct http_msg *msg,
                   struct hdr_idx *hdr_idx, const char *text, int len)
{
      int bytes;

      bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
      if (!bytes)
            return -1;
      msg->eoh += bytes;
      return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
}

/*
 * Checks if <hdr> is exactly <name> for <len> chars, and ends with a colon.
 * If so, returns the position of the first non-space character relative to
 * <hdr>, or <end>-<hdr> if not found before. If no value is found, it tries
 * to return a pointer to the place after the first space. Returns 0 if the
 * header name does not match. Checks are case-insensitive.
 */
int http_header_match2(const char *hdr, const char *end,
                   const char *name, int len)
{
      const char *val;

      if (hdr + len >= end)
            return 0;
      if (hdr[len] != ':')
            return 0;
      if (strncasecmp(hdr, name, len) != 0)
            return 0;
      val = hdr + len + 1;
      while (val < end && HTTP_IS_SPHT(*val))
            val++;
      if ((val >= end) && (len + 2 <= end - hdr))
            return len + 2; /* we may replace starting from second space */
      return val - hdr;
}

/* Find the end of the header value contained between <s> and <e>.
 * See RFC2616, par 2.2 for more information. Note that it requires
 * a valid header to return a valid result.
 */
const char *find_hdr_value_end(const char *s, const char *e)
{
      int quoted, qdpair;

      quoted = qdpair = 0;
      for (; s < e; s++) {
            if (qdpair)                    qdpair = 0;
            else if (quoted && *s == '\\') qdpair = 1;
            else if (quoted && *s == '"')  quoted = 0;
            else if (*s == '"')            quoted = 1;
            else if (*s == ',')            return s;
      }
      return s;
}

/* Find the first or next occurrence of header <name> in message buffer <sol>
 * using headers index <idx>, and return it in the <ctx> structure. This
 * structure holds everything necessary to use the header and find next
 * occurrence. If its <idx> member is 0, the header is searched from the
 * beginning. Otherwise, the next occurrence is returned. The function returns
 * 1 when it finds a value, and 0 when there is no more.
 */
int http_find_header2(const char *name, int len,
                  const char *sol, struct hdr_idx *idx,
                  struct hdr_ctx *ctx)
{
      __label__ return_hdr, next_hdr;
      const char *eol, *sov;
      int cur_idx;

      if (ctx->idx) {
            /* We have previously returned a value, let's search
             * another one on the same line.
             */
            cur_idx = ctx->idx;
            sol = ctx->line;
            sov = sol + ctx->val + ctx->vlen;
            eol = sol + idx->v[cur_idx].len;

            if (sov >= eol)
                  /* no more values in this header */
                  goto next_hdr;

            /* values remaining for this header, skip the comma */
            sov++;
            while (sov < eol && http_is_lws[(unsigned char)*sov])
                  sov++;

            goto return_hdr;
      }

      /* first request for this header */
      sol += hdr_idx_first_pos(idx);
      cur_idx = hdr_idx_first_idx(idx);

      while (cur_idx) {
            eol = sol + idx->v[cur_idx].len;

            if (len == 0) {
                  /* No argument was passed, we want any header.
                   * To achieve this, we simply build a fake request. */
                  while (sol + len < eol && sol[len] != ':')
                        len++;
                  name = sol;
            }

            if ((len < eol - sol) &&
                (sol[len] == ':') &&
                (strncasecmp(sol, name, len) == 0)) {

                  sov = sol + len + 1;
                  while (sov < eol && http_is_lws[(unsigned char)*sov])
                        sov++;
            return_hdr:
                  ctx->line = sol;
                  ctx->idx  = cur_idx;
                  ctx->val  = sov - sol;

                  eol = find_hdr_value_end(sov, eol);
                  ctx->vlen = eol - sov;
                  return 1;
            }
      next_hdr:
            sol = eol + idx->v[cur_idx].cr + 1;
            cur_idx = idx->v[cur_idx].next;
      }
      return 0;
}

int http_find_header(const char *name,
                 const char *sol, struct hdr_idx *idx,
                 struct hdr_ctx *ctx)
{
      return http_find_header2(name, strlen(name), sol, idx, ctx);
}

/*
 * returns a message to the client ; the connection is shut down for read,
 * and the request is cleared so that no server connection can be initiated.
 * The client must be in a valid state for this (HEADER, DATA ...).
 * Nothing is performed on the server side. The message is contained in a
 * "chunk". If it is null, then an empty message is used.
 * The reply buffer doesn't need to be empty before this.
 */
void client_retnclose(struct session *s, const struct chunk *msg)
{
      EV_FD_CLR(s->cli_fd, DIR_RD);
      EV_FD_SET(s->cli_fd, DIR_WR);
      buffer_shutr(s->req);
      if (!tv_add_ifset(&s->rep->wex, &now, &s->fe->clitimeout))
            tv_eternity(&s->rep->wex);
      s->cli_state = CL_STSHUTR;
      buffer_flush(s->rep);
      if (msg->len)
            buffer_write(s->rep, msg->str, msg->len);
      s->req->l = 0;
}


/*
 * returns a message into the rep buffer, and flushes the req buffer.
 * The reply buffer doesn't need to be empty before this. The message
 * is contained in a "chunk". If it is null, then an empty message is
 * used.
 */
void client_return(struct session *s, const struct chunk *msg)
{
      buffer_flush(s->rep);
      if (msg->len)
            buffer_write(s->rep, msg->str, msg->len);
      s->req->l = 0;
}


/* This function turns the server state into the SV_STCLOSE, and sets
 * indicators accordingly. Note that if <status> is 0, or if the message
 * pointer is NULL, then no message is returned.
 */
void srv_close_with_err(struct session *t, int err, int finst,
                  int status, const struct chunk *msg)
{
      t->srv_state = SV_STCLOSE;
      if (status > 0 && msg) {
            t->txn.status = status;
            if (t->fe->mode == PR_MODE_HTTP)
                  client_return(t, msg);
      }
      if (!(t->flags & SN_ERR_MASK))
            t->flags |= err;
      if (!(t->flags & SN_FINST_MASK))
            t->flags |= finst;
}

/* This function returns the appropriate error location for the given session
 * and message.
 */

struct chunk *error_message(struct session *s, int msgnum)
{
      if (s->be->errmsg[msgnum].str)
            return &s->be->errmsg[msgnum];
      else if (s->fe->errmsg[msgnum].str)
            return &s->fe->errmsg[msgnum];
      else
            return &http_err_chunks[msgnum];
}

/*
 * returns HTTP_METH_NONE if there is nothing valid to read (empty or non-text
 * string), HTTP_METH_OTHER for unknown methods, or the identified method.
 */
static http_meth_t find_http_meth(const char *str, const int len)
{
      unsigned char m;
      const struct http_method_desc *h;

      m = ((unsigned)*str - 'A');

      if (m < 26) {
            for (h = http_methods[m]; h->len > 0; h++) {
                  if (unlikely(h->len != len))
                        continue;
                  if (likely(memcmp(str, h->text, h->len) == 0))
                        return h->meth;
            };
            return HTTP_METH_OTHER;
      }
      return HTTP_METH_NONE;

}

/* Processes the client and server jobs of a session task, then
 * puts it back to the wait queue in a clean state, or
 * cleans up its resources if it must be deleted. Returns
 * the time the task accepts to wait, or TIME_ETERNITY for
 * infinity.
 */
void process_session(struct task *t, struct timeval *next)
{
      struct session *s = t->context;
      int fsm_resync = 0;

      do {
            fsm_resync = 0;
            //fprintf(stderr,"before_cli:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
            fsm_resync |= process_cli(s);
            //fprintf(stderr,"cli/srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
            fsm_resync |= process_srv(s);
            //fprintf(stderr,"after_srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
      } while (fsm_resync);

      if (likely(s->cli_state != CL_STCLOSE || s->srv_state != SV_STCLOSE)) {
            s->req->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE;
            s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE;

            t->expire = s->req->rex;
            tv_min(&t->expire, &s->req->rex, &s->req->wex);
            tv_bound(&t->expire, &s->req->cex);
            tv_bound(&t->expire, &s->rep->rex);
            tv_bound(&t->expire, &s->rep->wex);

            /* restore t to its place in the task list */
            task_queue(t);

#ifdef DEBUG_FULL
            /* DEBUG code : this should never ever happen, otherwise it indicates
             * that a task still has something to do and will provoke a quick loop.
             */
            if (tv_remain2(&now, &t->expire) <= 0)
                  exit(100);
#endif
            *next = t->expire;
            return; /* nothing more to do */
      }

      s->fe->feconn--;
      if (s->flags & SN_BE_ASSIGNED)
            s->be->beconn--;
      actconn--;
    
      if (unlikely((global.mode & MODE_DEBUG) &&
                 (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)))) {
            int len;
            len = sprintf(trash, "%08x:%s.closed[%04x:%04x]\n",
                        s->uniq_id, s->be->id,
                        (unsigned short)s->cli_fd, (unsigned short)s->srv_fd);
            write(1, trash, len);
      }

      s->logs.t_close = tv_ms_elapsed(&s->logs.tv_accept, &now);
      if (s->req != NULL)
            s->logs.bytes_in = s->req->total;
      if (s->rep != NULL)
            s->logs.bytes_out = s->rep->total;

      s->fe->bytes_in  += s->logs.bytes_in;
      s->fe->bytes_out += s->logs.bytes_out;
      if (s->be != s->fe) {
            s->be->bytes_in  += s->logs.bytes_in;
            s->be->bytes_out += s->logs.bytes_out;
      }
      if (s->srv) {
            s->srv->bytes_in  += s->logs.bytes_in;
            s->srv->bytes_out += s->logs.bytes_out;
      }

      /* let's do a final log if we need it */
      if (s->logs.logwait && 
          !(s->flags & SN_MONITOR) &&
          (!(s->fe->options & PR_O_NULLNOLOG) || s->req->total)) {
            if (s->fe->to_log & LW_REQ)
                  http_sess_log(s);
            else
                  tcp_sess_log(s);
      }

      /* the task MUST not be in the run queue anymore */
      task_delete(t);
      session_free(s);
      task_free(t);
      tv_eternity(next);
}


extern const char sess_term_cond[8];
extern const char sess_fin_state[8];
extern const char *monthname[12];
const char sess_cookie[4]     = "NIDV";         /* No cookie, Invalid cookie, cookie for a Down server, Valid cookie */
const char sess_set_cookie[8] = "N1I3PD5R";     /* No set-cookie, unknown, Set-Cookie Inserted, unknown,
                                       Set-cookie seen and left unchanged (passive), Set-cookie Deleted,
                                       unknown, Set-cookie Rewritten */
struct pool_head *pool2_requri;
struct pool_head *pool2_capture;

/*
 * send a log for the session when we have enough info about it.
 * Will not log if the frontend has no log defined.
 */
static void http_sess_log(struct session *s)
{
      char pn[INET6_ADDRSTRLEN + strlen(":65535")];
      struct proxy *fe = s->fe;
      struct proxy *be = s->be;
      struct proxy *prx_log;
      struct http_txn *txn = &s->txn;
      int tolog;
      char *uri, *h;
      char *svid;
      struct tm *tm;
      static char tmpline[MAX_SYSLOG_LEN];
      int hdr;

      if (fe->logfac1 < 0 && fe->logfac2 < 0)
            return;
      prx_log = fe;

      if (s->cli_addr.ss_family == AF_INET)
            inet_ntop(AF_INET,
                    (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr,
                    pn, sizeof(pn));
      else
            inet_ntop(AF_INET6,
                    (const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr,
                    pn, sizeof(pn));

      tm = localtime((time_t *)&s->logs.tv_accept.tv_sec);


      /* FIXME: let's limit ourselves to frontend logging for now. */
      tolog = fe->to_log;

      h = tmpline;
      if (fe->to_log & LW_REQHDR &&
          txn->req.cap &&
          (h < tmpline + sizeof(tmpline) - 10)) {
            *(h++) = ' ';
            *(h++) = '{';
            for (hdr = 0; hdr < fe->nb_req_cap; hdr++) {
                  if (hdr)
                        *(h++) = '|';
                  if (txn->req.cap[hdr] != NULL)
                        h = encode_string(h, tmpline + sizeof(tmpline) - 7,
                                      '#', hdr_encode_map, txn->req.cap[hdr]);
            }
            *(h++) = '}';
      }

      if (fe->to_log & LW_RSPHDR &&
          txn->rsp.cap &&
          (h < tmpline + sizeof(tmpline) - 7)) {
            *(h++) = ' ';
            *(h++) = '{';
            for (hdr = 0; hdr < fe->nb_rsp_cap; hdr++) {
                  if (hdr)
                        *(h++) = '|';
                  if (txn->rsp.cap[hdr] != NULL)
                        h = encode_string(h, tmpline + sizeof(tmpline) - 4,
                                      '#', hdr_encode_map, txn->rsp.cap[hdr]);
            }
            *(h++) = '}';
      }

      if (h < tmpline + sizeof(tmpline) - 4) {
            *(h++) = ' ';
            *(h++) = '"';
            uri = txn->uri ? txn->uri : "<BADREQ>";
            h = encode_string(h, tmpline + sizeof(tmpline) - 1,
                          '#', url_encode_map, uri);
            *(h++) = '"';
      }
      *h = '\0';

      svid = (tolog & LW_SVID) ?
            (s->data_source != DATA_SRC_STATS) ?
            (s->srv != NULL) ? s->srv->id : "<NOSRV>" : "<STATS>" : "-";

      send_log(prx_log, LOG_INFO,
             "%s:%d [%02d/%s/%04d:%02d:%02d:%02d.%03d]"
             " %s %s/%s %d/%d/%d/%d/%s%d %d %s%lld"
             " %s %s %c%c%c%c %d/%d/%d/%d %d/%d%s\n",
             pn,
             (s->cli_addr.ss_family == AF_INET) ?
             ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) :
             ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port),
             tm->tm_mday, monthname[tm->tm_mon], tm->tm_year+1900,
             tm->tm_hour, tm->tm_min, tm->tm_sec, s->logs.tv_accept.tv_usec/1000,
             fe->id, be->id, svid,
             s->logs.t_request,
             (s->logs.t_queue >= 0) ? s->logs.t_queue - s->logs.t_request : -1,
             (s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1,
             (s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1,
             (tolog & LW_BYTES) ? "" : "+", s->logs.t_close,
             txn->status,
             (tolog & LW_BYTES) ? "" : "+", s->logs.bytes_in,
             txn->cli_cookie ? txn->cli_cookie : "-",
             txn->srv_cookie ? txn->srv_cookie : "-",
             sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT],
             sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT],
             (be->options & PR_O_COOK_ANY) ? sess_cookie[(txn->flags & TX_CK_MASK) >> TX_CK_SHIFT] : '-',
             (be->options & PR_O_COOK_ANY) ? sess_set_cookie[(txn->flags & TX_SCK_MASK) >> TX_SCK_SHIFT] : '-',
             actconn, fe->feconn, be->beconn, s->srv ? s->srv->cur_sess : 0,
             s->logs.srv_queue_size, s->logs.prx_queue_size, tmpline);

      s->logs.logwait = 0;
}


/*
 * Capture headers from message starting at <som> according to header list
 * <cap_hdr>, and fill the <idx> structure appropriately.
 */
void capture_headers(char *som, struct hdr_idx *idx,
                 char **cap, struct cap_hdr *cap_hdr)
{
      char *eol, *sol, *col, *sov;
      int cur_idx;
      struct cap_hdr *h;
      int len;

      sol = som + hdr_idx_first_pos(idx);
      cur_idx = hdr_idx_first_idx(idx);

      while (cur_idx) {
            eol = sol + idx->v[cur_idx].len;

            col = sol;
            while (col < eol && *col != ':')
                  col++;

            sov = col + 1;
            while (sov < eol && http_is_lws[(unsigned char)*sov])
                  sov++;
                        
            for (h = cap_hdr; h; h = h->next) {
                  if ((h->namelen == col - sol) &&
                      (strncasecmp(sol, h->name, h->namelen) == 0)) {
                        if (cap[h->index] == NULL)
                              cap[h->index] =
                                    pool_alloc2(h->pool);

                        if (cap[h->index] == NULL) {
                              Alert("HTTP capture : out of memory.\n");
                              continue;
                        }
                                          
                        len = eol - sov;
                        if (len > h->len)
                              len = h->len;
                                          
                        memcpy(cap[h->index], sov, len);
                        cap[h->index][len]=0;
                  }
            }
            sol = eol + idx->v[cur_idx].cr + 1;
            cur_idx = idx->v[cur_idx].next;
      }
}


/* either we find an LF at <ptr> or we jump to <bad>.
 */
#define EXPECT_LF_HERE(ptr, bad)    do { if (unlikely(*(ptr) != '\n')) goto bad; } while (0)

/* plays with variables <ptr>, <end> and <state>. Jumps to <good> if OK,
 * otherwise to <http_msg_ood> with <state> set to <st>.
 */
#define EAT_AND_JUMP_OR_RETURN(good, st)   do { \
            ptr++;                          \
            if (likely(ptr < end))          \
                  goto good;              \
            else {                          \
                  state = (st);           \
                  goto http_msg_ood;      \
            }                               \
      } while (0)


/*
 * This function parses a status line between <ptr> and <end>, starting with
 * parser state <state>. Only states HTTP_MSG_RPVER, HTTP_MSG_RPVER_SP,
 * HTTP_MSG_RPCODE, HTTP_MSG_RPCODE_SP and HTTP_MSG_RPREASON are handled. Others
 * will give undefined results.
 * Note that it is upon the caller's responsibility to ensure that ptr < end,
 * and that msg->sol points to the beginning of the response.
 * If a complete line is found (which implies that at least one CR or LF is
 * found before <end>, the updated <ptr> is returned, otherwise NULL is
 * returned indicating an incomplete line (which does not mean that parts have
 * not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
 * non-NULL, they are fed with the new <ptr> and <state> values to be passed
 * upon next call.
 *
 * This function was intentionally designed to be called from
 * http_msg_analyzer() with the lowest overhead. It should integrate perfectly
 * within its state machine and use the same macros, hence the need for same
 * labels and variable names. Note that msg->sol is left unchanged.
 */
const char *http_parse_stsline(struct http_msg *msg, const char *msg_buf, int state,
                         const char *ptr, const char *end,
                         char **ret_ptr, int *ret_state)
{
      __label__
            http_msg_rpver,
            http_msg_rpver_sp,
            http_msg_rpcode,
            http_msg_rpcode_sp,
            http_msg_rpreason,
            http_msg_rpline_eol,
            http_msg_ood,     /* out of data */
            http_msg_invalid;

      switch (state)    {
      http_msg_rpver:
      case HTTP_MSG_RPVER:
            if (likely(HTTP_IS_VER_TOKEN(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpver, HTTP_MSG_RPVER);

            if (likely(HTTP_IS_SPHT(*ptr))) {
                  msg->sl.st.v_l = (ptr - msg_buf) - msg->som;
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
            }
            goto http_msg_invalid;
            
      http_msg_rpver_sp:
      case HTTP_MSG_RPVER_SP:
            if (likely(!HTTP_IS_LWS(*ptr))) {
                  msg->sl.st.c = ptr - msg_buf;
                  goto http_msg_rpcode;
            }
            if (likely(HTTP_IS_SPHT(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
            /* so it's a CR/LF, this is invalid */
            goto http_msg_invalid;

      http_msg_rpcode:
      case HTTP_MSG_RPCODE:
            if (likely(!HTTP_IS_LWS(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpcode, HTTP_MSG_RPCODE);

            if (likely(HTTP_IS_SPHT(*ptr))) {
                  msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
            }

            /* so it's a CR/LF, so there is no reason phrase */
            msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
      http_msg_rsp_reason:
            /* FIXME: should we support HTTP responses without any reason phrase ? */
            msg->sl.st.r = ptr - msg_buf;
            msg->sl.st.r_l = 0;
            goto http_msg_rpline_eol;

      http_msg_rpcode_sp:
      case HTTP_MSG_RPCODE_SP:
            if (likely(!HTTP_IS_LWS(*ptr))) {
                  msg->sl.st.r = ptr - msg_buf;
                  goto http_msg_rpreason;
            }
            if (likely(HTTP_IS_SPHT(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
            /* so it's a CR/LF, so there is no reason phrase */
            goto http_msg_rsp_reason;

      http_msg_rpreason:
      case HTTP_MSG_RPREASON:
            if (likely(!HTTP_IS_CRLF(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpreason, HTTP_MSG_RPREASON);
            msg->sl.st.r_l = (ptr - msg_buf) - msg->sl.st.r;
      http_msg_rpline_eol:
            /* We have seen the end of line. Note that we do not
             * necessarily have the \n yet, but at least we know that we
             * have EITHER \r OR \n, otherwise the response would not be
             * complete. We can then record the response length and return
             * to the caller which will be able to register it.
             */
            msg->sl.st.l = ptr - msg->sol;
            return ptr;

#ifdef DEBUG_FULL
      default:
            fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
            exit(1);
#endif
      }

 http_msg_ood:
      /* out of data */
      if (ret_state)
            *ret_state = state;
      if (ret_ptr)
            *ret_ptr = (char *)ptr;
      return NULL;

 http_msg_invalid:
      /* invalid message */
      if (ret_state)
            *ret_state = HTTP_MSG_ERROR;
      return NULL;
}


/*
 * This function parses a request line between <ptr> and <end>, starting with
 * parser state <state>. Only states HTTP_MSG_RQMETH, HTTP_MSG_RQMETH_SP,
 * HTTP_MSG_RQURI, HTTP_MSG_RQURI_SP and HTTP_MSG_RQVER are handled. Others
 * will give undefined results.
 * Note that it is upon the caller's responsibility to ensure that ptr < end,
 * and that msg->sol points to the beginning of the request.
 * If a complete line is found (which implies that at least one CR or LF is
 * found before <end>, the updated <ptr> is returned, otherwise NULL is
 * returned indicating an incomplete line (which does not mean that parts have
 * not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
 * non-NULL, they are fed with the new <ptr> and <state> values to be passed
 * upon next call.
 *
 * This function was intentionally designed to be called from
 * http_msg_analyzer() with the lowest overhead. It should integrate perfectly
 * within its state machine and use the same macros, hence the need for same
 * labels and variable names. Note that msg->sol is left unchanged.
 */
const char *http_parse_reqline(struct http_msg *msg, const char *msg_buf, int state,
                         const char *ptr, const char *end,
                         char **ret_ptr, int *ret_state)
{
      __label__
            http_msg_rqmeth,
            http_msg_rqmeth_sp,
            http_msg_rquri,
            http_msg_rquri_sp,
            http_msg_rqver,
            http_msg_rqline_eol,
            http_msg_ood,     /* out of data */
            http_msg_invalid;

      switch (state)    {
      http_msg_rqmeth:
      case HTTP_MSG_RQMETH:
            if (likely(HTTP_IS_TOKEN(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth, HTTP_MSG_RQMETH);

            if (likely(HTTP_IS_SPHT(*ptr))) {
                  msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
                  EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
            }

            if (likely(HTTP_IS_CRLF(*ptr))) {
                  /* HTTP 0.9 request */
                  msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
            http_msg_req09_uri:
                  msg->sl.rq.u = ptr - msg_buf;
            http_msg_req09_uri_e:
                  msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
            http_msg_req09_ver:
                  msg->sl.rq.v = ptr - msg_buf;
                  msg->sl.rq.v_l = 0;
                  goto http_msg_rqline_eol;
            }
            goto http_msg_invalid;
            
      http_msg_rqmeth_sp:
      case HTTP_MSG_RQMETH_SP:
            if (likely(!HTTP_IS_LWS(*ptr))) {
                  msg->sl.rq.u = ptr - msg_buf;
                  goto http_msg_rquri;
            }
            if (likely(HTTP_IS_SPHT(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
            /* so it's a CR/LF, meaning an HTTP 0.9 request */
            goto http_msg_req09_uri;

      http_msg_rquri:
      case HTTP_MSG_RQURI:
            if (likely(!HTTP_IS_LWS(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rquri, HTTP_MSG_RQURI);

            if (likely(HTTP_IS_SPHT(*ptr))) {
                  msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
                  EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
            }

            /* so it's a CR/LF, meaning an HTTP 0.9 request */
            goto http_msg_req09_uri_e;

      http_msg_rquri_sp:
      case HTTP_MSG_RQURI_SP:
            if (likely(!HTTP_IS_LWS(*ptr))) {
                  msg->sl.rq.v = ptr - msg_buf;
                  goto http_msg_rqver;
            }
            if (likely(HTTP_IS_SPHT(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
            /* so it's a CR/LF, meaning an HTTP 0.9 request */
            goto http_msg_req09_ver;

      http_msg_rqver:
      case HTTP_MSG_RQVER:
            if (likely(HTTP_IS_VER_TOKEN(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rqver, HTTP_MSG_RQVER);

            if (likely(HTTP_IS_CRLF(*ptr))) {
                  msg->sl.rq.v_l = (ptr - msg_buf) - msg->sl.rq.v;
            http_msg_rqline_eol:
                  /* We have seen the end of line. Note that we do not
                   * necessarily have the \n yet, but at least we know that we
                   * have EITHER \r OR \n, otherwise the request would not be
                   * complete. We can then record the request length and return
                   * to the caller which will be able to register it.
                   */
                  msg->sl.rq.l = ptr - msg->sol;
                  return ptr;
            }

            /* neither an HTTP_VER token nor a CRLF */
            goto http_msg_invalid;

#ifdef DEBUG_FULL
      default:
            fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
            exit(1);
#endif
      }

 http_msg_ood:
      /* out of data */
      if (ret_state)
            *ret_state = state;
      if (ret_ptr)
            *ret_ptr = (char *)ptr;
      return NULL;

 http_msg_invalid:
      /* invalid message */
      if (ret_state)
            *ret_state = HTTP_MSG_ERROR;
      return NULL;
}


/*
 * This function parses an HTTP message, either a request or a response,
 * depending on the initial msg->msg_state. It can be preempted everywhere
 * when data are missing and recalled at the exact same location with no
 * information loss. The header index is re-initialized when switching from
 * MSG_R[PQ]BEFORE to MSG_RPVER|MSG_RQMETH. It modifies msg->sol among other
 * fields.
 */
void http_msg_analyzer(struct buffer *buf, struct http_msg *msg, struct hdr_idx *idx)
{
      __label__
            http_msg_rqbefore,
            http_msg_rqbefore_cr,
            http_msg_rqmeth,
            http_msg_rqline_end,
            http_msg_hdr_first,
            http_msg_hdr_name,
            http_msg_hdr_l1_sp,
            http_msg_hdr_l1_lf,
            http_msg_hdr_l1_lws,
            http_msg_hdr_val,
            http_msg_hdr_l2_lf,
            http_msg_hdr_l2_lws,
            http_msg_complete_header,
            http_msg_last_lf,
            http_msg_ood,     /* out of data */
            http_msg_invalid;

      int state;                /* updated only when leaving the FSM */
      register char *ptr, *end; /* request pointers, to avoid dereferences */

      state = msg->msg_state;
      ptr = buf->lr;
      end = buf->r;

      if (unlikely(ptr >= end))
            goto http_msg_ood;

      switch (state)    {
      /*
       * First, states that are specific to the response only.
       * We check them first so that request and headers are
       * closer to each other (accessed more often).
       */
      http_msg_rpbefore:
      case HTTP_MSG_RPBEFORE:
            if (likely(HTTP_IS_TOKEN(*ptr))) {
                  if (likely(ptr == buf->data)) {
                        msg->sol = ptr;
                        msg->som = 0;
                  } else {
#if PARSE_PRESERVE_EMPTY_LINES
                        /* only skip empty leading lines, don't remove them */
                        msg->sol = ptr;
                        msg->som = ptr - buf->data;
#else
                        /* Remove empty leading lines, as recommended by
                         * RFC2616. This takes a lot of time because we
                         * must move all the buffer backwards, but this
                         * is rarely needed. The method above will be
                         * cleaner when we'll be able to start sending
                         * the request from any place in the buffer.
                         */
                        buf->lr = ptr;
                        buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
                        msg->som = 0;
                        msg->sol = buf->data;
                        ptr = buf->data;
                        end = buf->r;
#endif
                  }
                  hdr_idx_init(idx);
                  state = HTTP_MSG_RPVER;
                  goto http_msg_rpver;
            }

            if (unlikely(!HTTP_IS_CRLF(*ptr)))
                  goto http_msg_invalid;

            if (unlikely(*ptr == '\n'))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
            EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore_cr, HTTP_MSG_RPBEFORE_CR);
            /* stop here */

      http_msg_rpbefore_cr:
      case HTTP_MSG_RPBEFORE_CR:
            EXPECT_LF_HERE(ptr, http_msg_invalid);
            EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
            /* stop here */

      http_msg_rpver:
      case HTTP_MSG_RPVER:
      case HTTP_MSG_RPVER_SP:
      case HTTP_MSG_RPCODE:
      case HTTP_MSG_RPCODE_SP:
      case HTTP_MSG_RPREASON:
            ptr = (char *)http_parse_stsline(msg, buf->data, state, ptr, end,
                                     &buf->lr, &msg->msg_state);
            if (unlikely(!ptr))
                  return;

            /* we have a full response and we know that we have either a CR
             * or an LF at <ptr>.
             */
            //fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.st.l, *ptr);
            hdr_idx_set_start(idx, msg->sl.st.l, *ptr == '\r');

            msg->sol = ptr;
            if (likely(*ptr == '\r'))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rpline_end, HTTP_MSG_RPLINE_END);
            goto http_msg_rpline_end;

      http_msg_rpline_end:
      case HTTP_MSG_RPLINE_END:
            /* msg->sol must point to the first of CR or LF. */
            EXPECT_LF_HERE(ptr, http_msg_invalid);
            EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
            /* stop here */

      /*
       * Second, states that are specific to the request only
       */
      http_msg_rqbefore:
      case HTTP_MSG_RQBEFORE:
            if (likely(HTTP_IS_TOKEN(*ptr))) {
                  if (likely(ptr == buf->data)) {
                        msg->sol = ptr;
                        msg->som = 0;
                  } else {
#if PARSE_PRESERVE_EMPTY_LINES
                        /* only skip empty leading lines, don't remove them */
                        msg->sol = ptr;
                        msg->som = ptr - buf->data;
#else
                        /* Remove empty leading lines, as recommended by
                         * RFC2616. This takes a lot of time because we
                         * must move all the buffer backwards, but this
                         * is rarely needed. The method above will be
                         * cleaner when we'll be able to start sending
                         * the request from any place in the buffer.
                         */
                        buf->lr = ptr;
                        buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
                        msg->som = 0;
                        msg->sol = buf->data;
                        ptr = buf->data;
                        end = buf->r;
#endif
                  }
                  /* we will need this when keep-alive will be supported
                     hdr_idx_init(idx);
                   */
                  state = HTTP_MSG_RQMETH;
                  goto http_msg_rqmeth;
            }

            if (unlikely(!HTTP_IS_CRLF(*ptr)))
                  goto http_msg_invalid;

            if (unlikely(*ptr == '\n'))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
            EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore_cr, HTTP_MSG_RQBEFORE_CR);
            /* stop here */

      http_msg_rqbefore_cr:
      case HTTP_MSG_RQBEFORE_CR:
            EXPECT_LF_HERE(ptr, http_msg_invalid);
            EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
            /* stop here */

      http_msg_rqmeth:
      case HTTP_MSG_RQMETH:
      case HTTP_MSG_RQMETH_SP:
      case HTTP_MSG_RQURI:
      case HTTP_MSG_RQURI_SP:
      case HTTP_MSG_RQVER:
            ptr = (char *)http_parse_reqline(msg, buf->data, state, ptr, end,
                                     &buf->lr, &msg->msg_state);
            if (unlikely(!ptr))
                  return;

            /* we have a full request and we know that we have either a CR
             * or an LF at <ptr>.
             */
            //fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.rq.l, *ptr);
            hdr_idx_set_start(idx, msg->sl.rq.l, *ptr == '\r');

            msg->sol = ptr;
            if (likely(*ptr == '\r'))
                  EAT_AND_JUMP_OR_RETURN(http_msg_rqline_end, HTTP_MSG_RQLINE_END);
            goto http_msg_rqline_end;

      http_msg_rqline_end:
      case HTTP_MSG_RQLINE_END:
            /* check for HTTP/0.9 request : no version information available.
             * msg->sol must point to the first of CR or LF.
             */
            if (unlikely(msg->sl.rq.v_l == 0))
                  goto http_msg_last_lf;

            EXPECT_LF_HERE(ptr, http_msg_invalid);
            EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
            /* stop here */

      /*
       * Common states below
       */
      http_msg_hdr_first:
      case HTTP_MSG_HDR_FIRST:
            msg->sol = ptr;
            if (likely(!HTTP_IS_CRLF(*ptr))) {
                  goto http_msg_hdr_name;
            }
            
            if (likely(*ptr == '\r'))
                  EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
            goto http_msg_last_lf;

      http_msg_hdr_name:
      case HTTP_MSG_HDR_NAME:
            /* assumes msg->sol points to the first char */
            if (likely(HTTP_IS_TOKEN(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_hdr_name, HTTP_MSG_HDR_NAME);

            if (likely(*ptr == ':')) {
                  msg->col = ptr - buf->data;
                  EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);
            }

            goto http_msg_invalid;

      http_msg_hdr_l1_sp:
      case HTTP_MSG_HDR_L1_SP:
            /* assumes msg->sol points to the first char and msg->col to the colon */
            if (likely(HTTP_IS_SPHT(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);

            /* header value can be basically anything except CR/LF */
            msg->sov = ptr - buf->data;

            if (likely(!HTTP_IS_CRLF(*ptr))) {
                  goto http_msg_hdr_val;
            }
                  
            if (likely(*ptr == '\r'))
                  EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lf, HTTP_MSG_HDR_L1_LF);
            goto http_msg_hdr_l1_lf;

      http_msg_hdr_l1_lf:
      case HTTP_MSG_HDR_L1_LF:
            EXPECT_LF_HERE(ptr, http_msg_invalid);
            EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lws, HTTP_MSG_HDR_L1_LWS);

      http_msg_hdr_l1_lws:
      case HTTP_MSG_HDR_L1_LWS:
            if (likely(HTTP_IS_SPHT(*ptr))) {
                  /* replace HT,CR,LF with spaces */
                  for (; buf->data+msg->sov < ptr; msg->sov++)
                        buf->data[msg->sov] = ' ';
                  goto http_msg_hdr_l1_sp;
            }
            /* we had a header consisting only in spaces ! */
            msg->eol = buf->data + msg->sov;
            goto http_msg_complete_header;
            
      http_msg_hdr_val:
      case HTTP_MSG_HDR_VAL:
            /* assumes msg->sol points to the first char, msg->col to the
             * colon, and msg->sov points to the first character of the
             * value.
             */
            if (likely(!HTTP_IS_CRLF(*ptr)))
                  EAT_AND_JUMP_OR_RETURN(http_msg_hdr_val, HTTP_MSG_HDR_VAL);

            msg->eol = ptr;
            /* Note: we could also copy eol into ->eoh so that we have the
             * real header end in case it ends with lots of LWS, but is this
             * really needed ?
             */
            if (likely(*ptr == '\r'))
                  EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lf, HTTP_MSG_HDR_L2_LF);
            goto http_msg_hdr_l2_lf;

      http_msg_hdr_l2_lf:
      case HTTP_MSG_HDR_L2_LF:
            EXPECT_LF_HERE(ptr, http_msg_invalid);
            EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lws, HTTP_MSG_HDR_L2_LWS);

      http_msg_hdr_l2_lws:
      case HTTP_MSG_HDR_L2_LWS:
            if (unlikely(HTTP_IS_SPHT(*ptr))) {
                  /* LWS: replace HT,CR,LF with spaces */
                  for (; msg->eol < ptr; msg->eol++)
                        *msg->eol = ' ';
                  goto http_msg_hdr_val;
            }
      http_msg_complete_header:
            /*
             * It was a new header, so the last one is finished.
             * Assumes msg->sol points to the first char, msg->col to the
             * colon, msg->sov points to the first character of the value
             * and msg->eol to the first CR or LF so we know how the line
             * ends. We insert last header into the index.
             */
            /*
              fprintf(stderr,"registering %-2d bytes : ", msg->eol - msg->sol);
              write(2, msg->sol, msg->eol-msg->sol);
              fprintf(stderr,"\n");
            */

            if (unlikely(hdr_idx_add(msg->eol - msg->sol, *msg->eol == '\r',
                               idx, idx->tail) < 0))
                  goto http_msg_invalid;

            msg->sol = ptr;
            if (likely(!HTTP_IS_CRLF(*ptr))) {
                  goto http_msg_hdr_name;
            }
            
            if (likely(*ptr == '\r'))
                  EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
            goto http_msg_last_lf;

      http_msg_last_lf:
      case HTTP_MSG_LAST_LF:
            /* Assumes msg->sol points to the first of either CR or LF */
            EXPECT_LF_HERE(ptr, http_msg_invalid);
            ptr++;
            buf->lr = ptr;
            msg->eoh = msg->sol - buf->data;
            msg->msg_state = HTTP_MSG_BODY;
            return;
#ifdef DEBUG_FULL
      default:
            fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
            exit(1);
#endif
      }
 http_msg_ood:
      /* out of data */
      msg->msg_state = state;
      buf->lr = ptr;
      return;

 http_msg_invalid:
      /* invalid message */
      msg->msg_state = HTTP_MSG_ERROR;
      return;
}
    
/*
 * manages the client FSM and its socket. BTW, it also tries to handle the
 * cookie. It returns 1 if a state has changed (and a resync may be needed),
 * 0 else.
 */
int process_cli(struct session *t)
{
      int s = t->srv_state;
      int c = t->cli_state;
      struct buffer *req = t->req;
      struct buffer *rep = t->rep;

      DPRINTF(stderr,"process_cli: c=%s s=%s set(r,w)=%d,%d exp(r,w)=%d.%d,%d.%d\n",
            cli_stnames[c], srv_stnames[s],
            EV_FD_ISSET(t->cli_fd, DIR_RD), EV_FD_ISSET(t->cli_fd, DIR_WR),
            req->rex.tv_sec, req->rex.tv_usec,
            rep->wex.tv_sec, rep->wex.tv_usec);

      if (c == CL_STHEADERS) {
            /*
             * Now parse the partial (or complete) lines.
             * We will check the request syntax, and also join multi-line
             * headers. An index of all the lines will be elaborated while
             * parsing.
             *
             * For the parsing, we use a 28 states FSM.
             *
             * Here is the information we currently have :
             *   req->data + req->som  = beginning of request
             *   req->data + req->eoh  = end of processed headers / start of current one
             *   req->data + req->eol  = end of current header or line (LF or CRLF)
             *   req->lr = first non-visited byte
             *   req->r  = end of data
             */

            int cur_idx;
            struct http_txn *txn = &t->txn;
            struct http_msg *msg = &txn->req;
            struct proxy *cur_proxy;

            if (likely(req->lr < req->r))
                  http_msg_analyzer(req, msg, &txn->hdr_idx);

            /* 1: we might have to print this header in debug mode */
            if (unlikely((global.mode & MODE_DEBUG) &&
                       (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
                       (msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
                  char *eol, *sol;

                  sol = req->data + msg->som;
                  eol = sol + msg->sl.rq.l;
                  debug_hdr("clireq", t, sol, eol);

                  sol += hdr_idx_first_pos(&txn->hdr_idx);
                  cur_idx = hdr_idx_first_idx(&txn->hdr_idx);

                  while (cur_idx) {
                        eol = sol + txn->hdr_idx.v[cur_idx].len;
                        debug_hdr("clihdr", t, sol, eol);
                        sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
                        cur_idx = txn->hdr_idx.v[cur_idx].next;
                  }
            }


            /*
             * Now we quickly check if we have found a full valid request.
             * If not so, we check the FD and buffer states before leaving.
             * A full request is indicated by the fact that we have seen
             * the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
             * requests are checked first.
             *
             */

            if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
                  /*
                   * First, let's catch bad requests.
                   */
                  if (unlikely(msg->msg_state == HTTP_MSG_ERROR))
                        goto return_bad_req;

                  /* 1: Since we are in header mode, if there's no space
                   *    left for headers, we won't be able to free more
                   *    later, so the session will never terminate. We
                   *    must terminate it now.
                   */
                  if (unlikely(req->l >= req->rlim - req->data)) {
                        /* FIXME: check if URI is set and return Status
                         * 414 Request URI too long instead.
                         */
                        goto return_bad_req;
                  }

                  /* 2: have we encountered a read error or a close ? */
                  else if (unlikely(req->flags & (BF_READ_ERROR | BF_READ_NULL))) {
                        /* read error, or last read : give up. */
                        buffer_shutr(req);
                        fd_delete(t->cli_fd);
                        t->cli_state = CL_STCLOSE;
                        t->fe->failed_req++;
                        if (!(t->flags & SN_ERR_MASK))
                              t->flags |= SN_ERR_CLICL;
                        if (!(t->flags & SN_FINST_MASK))
                              t->flags |= SN_FINST_R;
                        return 1;
                  }

                  /* 3: has the read timeout expired ? */
                  else if (unlikely(tv_isle(&req->rex, &now))) {
                        /* read timeout : give up with an error message. */
                        txn->status = 408;
                        client_retnclose(t, error_message(t, HTTP_ERR_408));
                        t->fe->failed_req++;
                        if (!(t->flags & SN_ERR_MASK))
                              t->flags |= SN_ERR_CLITO;
                        if (!(t->flags & SN_FINST_MASK))
                              t->flags |= SN_FINST_R;
                        return 1;
                  }

                  /* 4: do we need to re-enable the read socket ? */
                  else if (unlikely(EV_FD_COND_S(t->cli_fd, DIR_RD))) {
                        /* fd in DIR_RD was disabled, perhaps because of a previous buffer
                         * full. We cannot loop here since stream_sock_read will disable it only if
                         * req->l == rlim-data
                         */
                        if (!tv_add_ifset(&req->rex, &now, &t->fe->clitimeout))
                              tv_eternity(&req->rex);
                  }
                  return t->cli_state != CL_STHEADERS;
            }


            /****************************************************************
             * More interesting part now : we know that we have a complete  *
             * request which at least looks like HTTP. We have an indicator *
             * of each header's length, so we can parse them quickly.       *
             ****************************************************************/

            /* ensure we keep this pointer to the beginning of the message */
            msg->sol = req->data + msg->som;

            /*
             * 1: identify the method
             */
            txn->meth = find_http_meth(&req->data[msg->som], msg->sl.rq.m_l);

            /*
             * 2: check if the URI matches the monitor_uri.
             * We have to do this for every request which gets in, because
             * the monitor-uri is defined by the frontend.
             */
            if (unlikely((t->fe->monitor_uri_len != 0) &&
                       (t->fe->monitor_uri_len == msg->sl.rq.u_l) &&
                       !memcmp(&req->data[msg->sl.rq.u],
                             t->fe->monitor_uri,
                             t->fe->monitor_uri_len))) {
                  /*
                   * We have found the monitor URI
                   */
                  t->flags |= SN_MONITOR;
                  txn->status = 200;
                  client_retnclose(t, &http_200_chunk);
                  goto return_prx_cond;
            }
                  
            /*
             * 3: Maybe we have to copy the original REQURI for the logs ?
             * Note: we cannot log anymore if the request has been
             * classified as invalid.
             */
            if (unlikely(t->logs.logwait & LW_REQ)) {
                  /* we have a complete HTTP request that we must log */
                  if ((txn->uri = pool_alloc2(pool2_requri)) != NULL) {
                        int urilen = msg->sl.rq.l;

                        if (urilen >= REQURI_LEN)
                              urilen = REQURI_LEN - 1;
                        memcpy(txn->uri, &req->data[msg->som], urilen);
                        txn->uri[urilen] = 0;

                        if (!(t->logs.logwait &= ~LW_REQ))
                              http_sess_log(t);
                  } else {
                        Alert("HTTP logging : out of memory.\n");
                  }
            }


            /* 4. We may have to convert HTTP/0.9 requests to HTTP/1.0 */
            if (unlikely(msg->sl.rq.v_l == 0)) {
                  int delta;
                  char *cur_end;
                  msg->sol = req->data + msg->som;
                  cur_end = msg->sol + msg->sl.rq.l;
                  delta = 0;

                  if (msg->sl.rq.u_l == 0) {
                        /* if no URI was set, add "/" */
                        delta = buffer_replace2(req, cur_end, cur_end, " /", 2);
                        cur_end += delta;
                        msg->eoh += delta;
                  }
                  /* add HTTP version */
                  delta = buffer_replace2(req, cur_end, cur_end, " HTTP/1.0\r\n", 11);
                  msg->eoh += delta;
                  cur_end += delta;
                  cur_end = (char *)http_parse_reqline(msg, req->data,
                                               HTTP_MSG_RQMETH,
                                               msg->sol, cur_end + 1,
                                               NULL, NULL);
                  if (unlikely(!cur_end))
                        goto return_bad_req;

                  /* we have a full HTTP/1.0 request now and we know that
                   * we have either a CR or an LF at <ptr>.
                   */
                  hdr_idx_set_start(&txn->hdr_idx, msg->sl.rq.l, *cur_end == '\r');
            }


            /* 5: we may need to capture headers */
            if (unlikely((t->logs.logwait & LW_REQHDR) && t->fe->req_cap))
                  capture_headers(req->data + msg->som, &txn->hdr_idx,
                              txn->req.cap, t->fe->req_cap);

            /*
             * 6: we will have to evaluate the filters.
             * As opposed to version 1.2, now they will be evaluated in the
             * filters order and not in the header order. This means that
             * each filter has to be validated among all headers.
             *
             * We can now check whether we want to switch to another
             * backend, in which case we will re-check the backend's
             * filters and various options. In order to support 3-level
             * switching, here's how we should proceed :
             *
             *  a) run be.
             *     if (switch) then switch ->be to the new backend.
             *  b) run be if (be != fe).
             *     There cannot be any switch from there, so ->be cannot be
             *     changed anymore.
             *
             * => filters always apply to ->be, then ->be may change.
             *
             * The response path will be able to apply either ->be, or
             * ->be then ->fe filters in order to match the reverse of
             * the forward sequence.
             */

            do {
                  struct acl_cond *cond;
                  struct proxy *rule_set = t->be;
                  cur_proxy = t->be;

                  /* first check whether we have some ACLs set to block this request */
                  list_for_each_entry(cond, &cur_proxy->block_cond, list) {
                        int ret = acl_exec_cond(cond, cur_proxy, t, txn, ACL_DIR_REQ);
                        if (cond->pol == ACL_COND_UNLESS)
                              ret = !ret;

                        if (ret) {
                              txn->status = 403;
                              /* let's log the request time */
                              t->logs.t_request = tv_ms_elapsed(&t->logs.tv_accept, &now);
                              client_retnclose(t, error_message(t, HTTP_ERR_403));
                              goto return_prx_cond;
                        }
                  }

                  /* try headers filters */
                  if (rule_set->req_exp != NULL) {
                        if (apply_filters_to_request(t, req, rule_set->req_exp) < 0)
                              goto return_bad_req;
                  }

                  if (!(t->flags & SN_BE_ASSIGNED) && (t->be != cur_proxy)) {
                        /* to ensure correct connection accounting on
                         * the backend, we count the connection for the
                         * one managing the queue.
                         */
                        t->be->beconn++;
                        if (t->be->beconn > t->be->beconn_max)
                              t->be->beconn_max = t->be->beconn;
                        t->be->cum_beconn++;
                        t->flags |= SN_BE_ASSIGNED;
                  }

                  /* has the request been denied ? */
                  if (txn->flags & TX_CLDENY) {
                        /* no need to go further */
                        txn->status = 403;
                        /* let's log the request time */
                        t->logs.t_request = tv_ms_elapsed(&t->logs.tv_accept, &now);
                        client_retnclose(t, error_message(t, HTTP_ERR_403));
                        goto return_prx_cond;
                  }

                  /* We might have to check for "Connection:" */
                  if (((t->fe->options | t->be->options) & PR_O_HTTP_CLOSE) &&
                      !(t->flags & SN_CONN_CLOSED)) {
                        char *cur_ptr, *cur_end, *cur_next;
                        int cur_idx, old_idx, delta, val;
                        struct hdr_idx_elem *cur_hdr;

                        cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
                        old_idx = 0;

                        while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
                              cur_hdr  = &txn->hdr_idx.v[cur_idx];
                              cur_ptr  = cur_next;
                              cur_end  = cur_ptr + cur_hdr->len;
                              cur_next = cur_end + cur_hdr->cr + 1;

                              val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
                              if (val) {
                                    /* 3 possibilities :
                                     * - we have already set Connection: close,
                                     *   so we remove this line.
                                     * - we have not yet set Connection: close,
                                     *   but this line indicates close. We leave
                                     *   it untouched and set the flag.
                                     * - we have not yet set Connection: close,
                                     *   and this line indicates non-close. We
                                     *   replace it.
                                     */
                                    if (t->flags & SN_CONN_CLOSED) {
                                          delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
                                          txn->req.eoh += delta;
                                          cur_next += delta;
                                          txn->hdr_idx.v[old_idx].next = cur_hdr->next;
                                          txn->hdr_idx.used--;
                                          cur_hdr->len = 0;
                                    } else {
                                          if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
                                                delta = buffer_replace2(req, cur_ptr + val, cur_end,
                                                                  "close", 5);
                                                cur_next += delta;
                                                cur_hdr->len += delta;
                                                txn->req.eoh += delta;
                                          }
                                          t->flags |= SN_CONN_CLOSED;
                                    }
                              }
                              old_idx = cur_idx;
                        }
                  }
                  /* add request headers from the rule sets in the same order */
                  for (cur_idx = 0; cur_idx < rule_set->nb_reqadd; cur_idx++) {
                        if (unlikely(http_header_add_tail(req,
                                                  &txn->req,
                                                  &txn->hdr_idx,
                                                  rule_set->req_add[cur_idx])) < 0)
                              goto return_bad_req;
                  }

                  /* check if stats URI was requested, and if an auth is needed */
                  if (rule_set->uri_auth != NULL &&
                      (txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)) {
                        /* we have to check the URI and auth for this request */
                        if (stats_check_uri_auth(t, rule_set))
                              return 1;
                  }

                  /* now check whether we have some switching rules for this request */
                  if (!(t->flags & SN_BE_ASSIGNED)) {
                        struct switching_rule *rule;

                        list_for_each_entry(rule, &cur_proxy->switching_rules, list) {
                              int ret;

                              ret = acl_exec_cond(rule->cond, cur_proxy, t, txn, ACL_DIR_REQ);
                              if (cond->pol == ACL_COND_UNLESS)
                                    ret = !ret;

                              if (ret) {
                                    t->be = rule->be.backend;
                                    t->be->beconn++;
                                    if (t->be->beconn > t->be->beconn_max)
                                          t->be->beconn_max = t->be->beconn;
                                    t->be->cum_beconn++;
                                    t->flags |= SN_BE_ASSIGNED;
                                    break;
                              }
                        }
                  }

                  if (!(t->flags & SN_BE_ASSIGNED) && cur_proxy->defbe.be) {
                        /* No backend was set, but there was a default
                         * backend set in the frontend, so we use it and
                         * loop again.
                         */
                        t->be = cur_proxy->defbe.be;
                        t->be->beconn++;
                        if (t->be->beconn > t->be->beconn_max)
                              t->be->beconn_max = t->be->beconn;
                        t->be->cum_beconn++;
                        t->flags |= SN_BE_ASSIGNED;
                  }
            } while (t->be != cur_proxy);  /* we loop only if t->be has changed */
            

            if (!(t->flags & SN_BE_ASSIGNED)) {
                  /* To ensure correct connection accounting on
                   * the backend, we count the connection for the
                   * one managing the queue.
                   */
                  t->be->beconn++;
                  if (t->be->beconn > t->be->beconn_max)
                        t->be->beconn_max = t->be->beconn;
                  t->be->cum_beconn++;
                  t->flags |= SN_BE_ASSIGNED;
            }

            /*
             * Right now, we know that we have processed the entire headers
             * and that unwanted requests have been filtered out. We can do
             * whatever we want with the remaining request. Also, now we
             * may have separate values for ->fe, ->be.
             */




            /*
             * 7: the appsession cookie was looked up very early in 1.2,
             * so let's do the same now.
             */

            /* It needs to look into the URI */
            if (t->be->appsession_name) {
                  get_srv_from_appsession(t, &req->data[msg->som], msg->sl.rq.l);
            }


            /*
             * 8: Now we can work with the cookies.
             * Note that doing so might move headers in the request, but
             * the fields will stay coherent and the URI will not move.
             * This should only be performed in the backend.
             */
            if (!(txn->flags & (TX_CLDENY|TX_CLTARPIT)))
                  manage_client_side_cookies(t, req);


            /*
             * 9: add X-Forwarded-For if either the frontend or the backend
             * asks for it.
             */
            if ((t->fe->options | t->be->options) & PR_O_FWDFOR) {
                  if (t->cli_addr.ss_family == AF_INET) {
                        /* Add an X-Forwarded-For header unless the source IP is
                         * in the 'except' network range.
                         */
                        if ((!t->fe->except_mask.s_addr ||
                             (((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->fe->except_mask.s_addr)
                             != t->fe->except_net.s_addr) &&
                            (!t->be->except_mask.s_addr ||
                             (((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->be->except_mask.s_addr)
                             != t->be->except_net.s_addr)) {
                              int len;
                              unsigned char *pn;
                              pn = (unsigned char *)&((struct sockaddr_in *)&t->cli_addr)->sin_addr;

                              len = sprintf(trash, "X-Forwarded-For: %d.%d.%d.%d",
                                          pn[0], pn[1], pn[2], pn[3]);

                              if (unlikely(http_header_add_tail2(req, &txn->req,
                                                         &txn->hdr_idx, trash, len)) < 0)
                                    goto return_bad_req;
                        }
                  }
                  else if (t->cli_addr.ss_family == AF_INET6) {
                        /* FIXME: for the sake of completeness, we should also support
                         * 'except' here, although it is mostly useless in this case.
                         */
                        int len;
                        char pn[INET6_ADDRSTRLEN];
                        inet_ntop(AF_INET6,
                                (const void *)&((struct sockaddr_in6 *)(&t->cli_addr))->sin6_addr,
                                pn, sizeof(pn));
                        len = sprintf(trash, "X-Forwarded-For: %s", pn);
                        if (unlikely(http_header_add_tail2(req, &txn->req,
                                                   &txn->hdr_idx, trash, len)) < 0)
                              goto return_bad_req;
                  }
            }

            /*
             * 10: add "Connection: close" if needed and not yet set.
             * Note that we do not need to add it in case of HTTP/1.0.
             */
            if (!(t->flags & SN_CONN_CLOSED) &&
                ((t->fe->options | t->be->options) & PR_O_HTTP_CLOSE)) {
                  if ((unlikely(msg->sl.rq.v_l != 8) ||
                       unlikely(req->data[msg->som + msg->sl.rq.v + 7] != '0')) &&
                      unlikely(http_header_add_tail2(req, &txn->req, &txn->hdr_idx,
                                             "Connection: close", 17)) < 0)
                        goto return_bad_req;
                  t->flags |= SN_CONN_CLOSED;
            }

            /*************************************************************
             * OK, that's finished for the headers. We have done what we *
             * could. Let's switch to the DATA state.                    *
             ************************************************************/

            t->cli_state = CL_STDATA;
            req->rlim = req->data + BUFSIZE; /* no more rewrite needed */

            t->logs.t_request = tv_ms_elapsed(&t->logs.tv_accept, &now);

            if (!tv_isset(&t->fe->clitimeout) ||
                (t->srv_state < SV_STDATA && tv_isset(&t->be->srvtimeout))) {
                  /* If the client has no timeout, or if the server is not ready yet,
                   * and we know for sure that it can expire, then it's cleaner to
                   * disable the timeout on the client side so that too low values
                   * cannot make the sessions abort too early.
                   *
                   * FIXME-20050705: the server needs a way to re-enable this time-out
                   * when it switches its state, otherwise a client can stay connected
                   * indefinitely. This now seems to be OK.
                   */
                  tv_eternity(&req->rex);
            }

            /* When a connection is tarpitted, we use the queue timeout for the
             * tarpit delay, which currently happens to be the server's connect
             * timeout. If unset, then set it to zero because we really want it
             * to expire at one moment.
             */
            if (txn->flags & TX_CLTARPIT) {
                  t->req->l = 0;
                  /* flush the request so that we can drop the connection early
                   * if the client closes first.
                   */
                  if (!tv_add_ifset(&req->cex, &now, &t->be->contimeout))
                        req->cex = now;
            }

            /* OK let's go on with the BODY now */
            goto process_data;

      return_bad_req: /* let's centralize all bad requests */
            txn->req.msg_state = HTTP_MSG_ERROR;
            txn->status = 400;
            client_retnclose(t, error_message(t, HTTP_ERR_400));
            t->fe->failed_req++;
      return_prx_cond:
            if (!(t->flags & SN_ERR_MASK))
                  t->flags |= SN_ERR_PRXCOND;
            if (!(t->flags & SN_FINST_MASK))
                  t->flags |= SN_FINST_R;
            return 1;

      }
      else if (c == CL_STDATA) {
      process_data:
            /* FIXME: this error handling is partly buggy because we always report
             * a 'DATA' phase while we don't know if the server was in IDLE, CONN
             * or HEADER phase. BTW, it's not logical to expire the client while
             * we're waiting for the server to connect.
             */
            /* read or write error */
            if (rep->flags & BF_WRITE_ERROR || req->flags & BF_READ_ERROR) {
                  buffer_shutr(req);
                  buffer_shutw(rep);
                  fd_delete(t->cli_fd);
                  t->cli_state = CL_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_CLICL;
                  if (!(t->flags & SN_FINST_MASK)) {
                        if (t->pend_pos)
                              t->flags |= SN_FINST_Q;
                        else if (s == SV_STCONN)
                              t->flags |= SN_FINST_C;
                        else
                              t->flags |= SN_FINST_D;
                  }
                  return 1;
            }
            /* last read, or end of server write */
            else if (req->flags & BF_READ_NULL || s == SV_STSHUTW || s == SV_STCLOSE) {
                  EV_FD_CLR(t->cli_fd, DIR_RD);
                  buffer_shutr(req);
                  t->cli_state = CL_STSHUTR;
                  return 1;
            }     
            /* last server read and buffer empty */
            else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)) {
                  EV_FD_CLR(t->cli_fd, DIR_WR);
                  buffer_shutw(rep);
                  shutdown(t->cli_fd, SHUT_WR);
                  /* We must ensure that the read part is still alive when switching
                   * to shutw */
                  EV_FD_SET(t->cli_fd, DIR_RD);
                  tv_add_ifset(&req->rex, &now, &t->fe->clitimeout);
                  t->cli_state = CL_STSHUTW;
                  //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
                  return 1;
            }
            /* read timeout */
            else if (tv_isle(&req->rex, &now)) {
                  EV_FD_CLR(t->cli_fd, DIR_RD);
                  buffer_shutr(req);
                  t->cli_state = CL_STSHUTR;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_CLITO;
                  if (!(t->flags & SN_FINST_MASK)) {
                        if (t->pend_pos)
                              t->flags |= SN_FINST_Q;
                        else if (s == SV_STCONN)
                              t->flags |= SN_FINST_C;
                        else
                              t->flags |= SN_FINST_D;
                  }
                  return 1;
            }     
            /* write timeout */
            else if (tv_isle(&rep->wex, &now)) {
                  EV_FD_CLR(t->cli_fd, DIR_WR);
                  buffer_shutw(rep);
                  shutdown(t->cli_fd, SHUT_WR);
                  /* We must ensure that the read part is still alive when switching
                   * to shutw */
                  EV_FD_SET(t->cli_fd, DIR_RD);
                  tv_add_ifset(&req->rex, &now, &t->fe->clitimeout);

                  t->cli_state = CL_STSHUTW;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_CLITO;
                  if (!(t->flags & SN_FINST_MASK)) {
                        if (t->pend_pos)
                              t->flags |= SN_FINST_Q;
                        else if (s == SV_STCONN)
                              t->flags |= SN_FINST_C;
                        else
                              t->flags |= SN_FINST_D;
                  }
                  return 1;
            }

            if (req->l >= req->rlim - req->data) {
                  /* no room to read more data */
                  if (EV_FD_COND_C(t->cli_fd, DIR_RD)) {
                        /* stop reading until we get some space */
                        tv_eternity(&req->rex);
                  }
            } else {
                  /* there's still some space in the buffer */
                  if (EV_FD_COND_S(t->cli_fd, DIR_RD)) {
                        if (!tv_isset(&t->fe->clitimeout) ||
                            (t->srv_state < SV_STDATA && tv_isset(&t->be->srvtimeout)))
                              /* If the client has no timeout, or if the server not ready yet, and we
                               * know for sure that it can expire, then it's cleaner to disable the
                               * timeout on the client side so that too low values cannot make the
                               * sessions abort too early.
                               */
                              tv_eternity(&req->rex);
                        else
                              tv_add(&req->rex, &now, &t->fe->clitimeout);
                  }
            }

            if ((rep->l == 0) ||
                ((s < SV_STDATA) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) {
                  if (EV_FD_COND_C(t->cli_fd, DIR_WR)) {
                        /* stop writing */
                        tv_eternity(&rep->wex);
                  }
            } else {
                  /* buffer not empty */
                  if (EV_FD_COND_S(t->cli_fd, DIR_WR)) {
                        /* restart writing */
                        if (tv_add_ifset(&rep->wex, &now, &t->fe->clitimeout)) {
                              /* FIXME: to prevent the client from expiring read timeouts during writes,
                               * we refresh it. */
                              req->rex = rep->wex;
                        }
                        else
                              tv_eternity(&rep->wex);
                  }
            }
            return 0; /* other cases change nothing */
      }
      else if (c == CL_STSHUTR) {
            if (rep->flags & BF_WRITE_ERROR) {
                  buffer_shutw(rep);
                  fd_delete(t->cli_fd);
                  t->cli_state = CL_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_CLICL;
                  if (!(t->flags & SN_FINST_MASK)) {
                        if (t->pend_pos)
                              t->flags |= SN_FINST_Q;
                        else if (s == SV_STCONN)
                              t->flags |= SN_FINST_C;
                        else
                              t->flags |= SN_FINST_D;
                  }
                  return 1;
            }
            else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)
                   && !(t->flags & SN_SELF_GEN)) {
                  buffer_shutw(rep);
                  fd_delete(t->cli_fd);
                  t->cli_state = CL_STCLOSE;
                  return 1;
            }
            else if (tv_isle(&rep->wex, &now)) {
                  buffer_shutw(rep);
                  fd_delete(t->cli_fd);
                  t->cli_state = CL_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_CLITO;
                  if (!(t->flags & SN_FINST_MASK)) {
                        if (t->pend_pos)
                              t->flags |= SN_FINST_Q;
                        else if (s == SV_STCONN)
                              t->flags |= SN_FINST_C;
                        else
                              t->flags |= SN_FINST_D;
                  }
                  return 1;
            }

            if (t->flags & SN_SELF_GEN) {
                  produce_content(t);
                  if (rep->l == 0) {
                        buffer_shutw(rep);
                        fd_delete(t->cli_fd);
                        t->cli_state = CL_STCLOSE;
                        return 1;
                  }
            }

            if ((rep->l == 0)
                || ((s == SV_STHEADERS) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) {
                  if (EV_FD_COND_C(t->cli_fd, DIR_WR)) {
                        /* stop writing */
                        tv_eternity(&rep->wex);
                  }
            } else {
                  /* buffer not empty */
                  if (EV_FD_COND_S(t->cli_fd, DIR_WR)) {
                        /* restart writing */
                        if (!tv_add_ifset(&rep->wex, &now, &t->fe->clitimeout))
                              tv_eternity(&rep->wex);
                  }
            }
            return 0;
      }
      else if (c == CL_STSHUTW) {
            if (req->flags & BF_READ_ERROR) {
                  buffer_shutr(req);
                  fd_delete(t->cli_fd);
                  t->cli_state = CL_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_CLICL;
                  if (!(t->flags & SN_FINST_MASK)) {
                        if (t->pend_pos)
                              t->flags |= SN_FINST_Q;
                        else if (s == SV_STCONN)
                              t->flags |= SN_FINST_C;
                        else
                              t->flags |= SN_FINST_D;
                  }
                  return 1;
            }
            else if (req->flags & BF_READ_NULL || s == SV_STSHUTW || s == SV_STCLOSE) {
                  buffer_shutr(req);
                  fd_delete(t->cli_fd);
                  t->cli_state = CL_STCLOSE;
                  return 1;
            }
            else if (tv_isle(&req->rex, &now)) {
                  buffer_shutr(req);
                  fd_delete(t->cli_fd);
                  t->cli_state = CL_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_CLITO;
                  if (!(t->flags & SN_FINST_MASK)) {
                        if (t->pend_pos)
                              t->flags |= SN_FINST_Q;
                        else if (s == SV_STCONN)
                              t->flags |= SN_FINST_C;
                        else
                              t->flags |= SN_FINST_D;
                  }
                  return 1;
            }
            else if (req->l >= req->rlim - req->data) {
                  /* no room to read more data */

                  /* FIXME-20050705: is it possible for a client to maintain a session
                   * after the timeout by sending more data after it receives a close ?
                   */

                  if (EV_FD_COND_C(t->cli_fd, DIR_RD)) {
                        /* stop reading until we get some space */
                        tv_eternity(&req->rex);
                        //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
                  }
            } else {
                  /* there's still some space in the buffer */
                  if (EV_FD_COND_S(t->cli_fd, DIR_RD)) {
                        if (!tv_add_ifset(&req->rex, &now, &t->fe->clitimeout))
                              tv_eternity(&req->rex);
                        //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
                  }
            }
            return 0;
      }
      else { /* CL_STCLOSE: nothing to do */
            if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
                  int len;
                  len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n", t->uniq_id, t->be->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
                  write(1, trash, len);
            }
            return 0;
      }
      return 0;
}


/*
 * manages the server FSM and its socket. It returns 1 if a state has changed
 * (and a resync may be needed), 0 else.
 */
int process_srv(struct session *t)
{
      int s = t->srv_state;
      int c = t->cli_state;
      struct http_txn *txn = &t->txn;
      struct buffer *req = t->req;
      struct buffer *rep = t->rep;
      int conn_err;

#ifdef DEBUG_FULL
      fprintf(stderr,"process_srv: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]);
#endif

#if 0
      fprintf(stderr,"%s:%d  fe->clito=%d.%d, fe->conto=%d.%d, fe->srvto=%d.%d\n",
            __FUNCTION__, __LINE__,
            t->fe->clitimeout.tv_sec, t->fe->clitimeout.tv_usec, 
            t->fe->contimeout.tv_sec, t->fe->contimeout.tv_usec, 
            t->fe->srvtimeout.tv_sec, t->fe->srvtimeout.tv_usec);
      fprintf(stderr,"%s:%d  be->clito=%d.%d, be->conto=%d.%d, be->srvto=%d.%d\n",
            __FUNCTION__, __LINE__,
            t->be->clitimeout.tv_sec, t->be->clitimeout.tv_usec, 
            t->be->contimeout.tv_sec, t->be->contimeout.tv_usec, 
            t->be->srvtimeout.tv_sec, t->be->srvtimeout.tv_usec);

      fprintf(stderr,"%s:%d  req->cto=%d.%d, req->rto=%d.%d, req->wto=%d.%d\n",
            __FUNCTION__, __LINE__,
            req->cto.tv_sec, req->cto.tv_usec, 
            req->rto.tv_sec, req->rto.tv_usec, 
            req->wto.tv_sec, req->wto.tv_usec);

      fprintf(stderr,"%s:%d  rep->cto=%d.%d, rep->rto=%d.%d, rep->wto=%d.%d\n",
            __FUNCTION__, __LINE__,
            rep->cto.tv_sec, rep->cto.tv_usec, 
            rep->rto.tv_sec, rep->rto.tv_usec, 
            rep->wto.tv_sec, rep->wto.tv_usec);
#endif

      //fprintf(stderr,"process_srv: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s,
      //EV_FD_ISSET(t->cli_fd, DIR_RD), EV_FD_ISSET(t->cli_fd, DIR_WR),
      //EV_FD_ISSET(t->srv_fd, DIR_RD), EV_FD_ISSET(t->srv_fd, DIR_WR)
      //);
      if (s == SV_STIDLE) {
            if (c == CL_STHEADERS)
                  return 0;   /* stay in idle, waiting for data to reach the client side */
            else if (c == CL_STCLOSE || c == CL_STSHUTW ||
                   (c == CL_STSHUTR &&
                    (t->req->l == 0 || t->be->options & PR_O_ABRT_CLOSE))) { /* give up */
                  tv_eternity(&req->cex);
                  if (t->pend_pos)
                        t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
                  /* note that this must not return any error because it would be able to
                   * overwrite the client_retnclose() output.
                   */
                  if (txn->flags & TX_CLTARPIT)
                        srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_T, 0, NULL);
                  else
                        srv_close_with_err(t, SN_ERR_CLICL, t->pend_pos ? SN_FINST_Q : SN_FINST_C, 0, NULL);

                  return 1;
            }
            else {
                  if (txn->flags & TX_CLTARPIT) {
                        /* This connection is being tarpitted. The CLIENT side has
                         * already set the connect expiration date to the right
                         * timeout. We just have to check that it has not expired.
                         */
                        if (!tv_isle(&req->cex, &now))
                              return 0;

                        /* We will set the queue timer to the time spent, just for
                         * logging purposes. We fake a 500 server error, so that the
                         * attacker will not suspect his connection has been tarpitted.
                         * It will not cause trouble to the logs because we can exclude
                         * the tarpitted connections by filtering on the 'PT' status flags.
                         */
                        tv_eternity(&req->cex);
                        t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
                        srv_close_with_err(t, SN_ERR_PRXCOND, SN_FINST_T,
                                       500, error_message(t, HTTP_ERR_500));
                        return 1;
                  }

                  /* Right now, we will need to create a connection to the server.
                   * We might already have tried, and got a connection pending, in
                   * which case we will not do anything till it's pending. It's up
                   * to any other session to release it and wake us up again.
                   */
                  if (t->pend_pos) {
                        if (!tv_isle(&req->cex, &now))
                              return 0;
                        else {
                              /* we've been waiting too long here */
                              tv_eternity(&req->cex);
                              t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
                              srv_close_with_err(t, SN_ERR_SRVTO, SN_FINST_Q,
                                             503, error_message(t, HTTP_ERR_503));
                              if (t->srv)
                                    t->srv->failed_conns++;
                              t->fe->failed_conns++;
                              return 1;
                        }
                  }

                  do {
                        /* first, get a connection */
                        if (srv_redispatch_connect(t))
                              return t->srv_state != SV_STIDLE;

                        /* try to (re-)connect to the server, and fail if we expire the
                         * number of retries.
                         */
                        if (srv_retryable_connect(t)) {
                              t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
                              return t->srv_state != SV_STIDLE;
                        }
                  } while (1);
            }
      }
      else if (s == SV_STCONN) { /* connection in progress */
            if (c == CL_STCLOSE || c == CL_STSHUTW ||
                (c == CL_STSHUTR &&
                 ((t->req->l == 0 && !(req->flags & BF_WRITE_STATUS)) ||
                  t->be->options & PR_O_ABRT_CLOSE))) { /* give up */
                  tv_eternity(&req->cex);
                  fd_delete(t->srv_fd);
                  if (t->srv)
                        t->srv->cur_sess--;

                  /* note that this must not return any error because it would be able to
                   * overwrite the client_retnclose() output.
                   */
                  srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_C, 0, NULL);
                  return 1;
            }
            if (!(req->flags & BF_WRITE_STATUS) && !tv_isle(&req->cex, &now)) {
                  //fprintf(stderr,"1: c=%d, s=%d, now=%d.%06d, exp=%d.%06d\n", c, s, now.tv_sec, now.tv_usec, req->cex.tv_sec, req->cex.tv_usec);
                  return 0; /* nothing changed */
            }
            else if (!(req->flags & BF_WRITE_STATUS) || (req->flags & BF_WRITE_ERROR)) {
                  /* timeout, asynchronous connect error or first write error */
                  //fprintf(stderr,"2: c=%d, s=%d\n", c, s);

                  fd_delete(t->srv_fd);
                  if (t->srv)
                        t->srv->cur_sess--;

                  if (!(req->flags & BF_WRITE_STATUS))
                        conn_err = SN_ERR_SRVTO; // it was a connect timeout.
                  else
                        conn_err = SN_ERR_SRVCL; // it was an asynchronous connect error.

                  /* ensure that we have enough retries left */
                  if (srv_count_retry_down(t, conn_err))
                        return 1;

                  if (t->srv && t->conn_retries == 0 && t->be->options & PR_O_REDISP) {
                        /* We're on our last chance, and the REDISP option was specified.
                         * We will ignore cookie and force to balance or use the dispatcher.
                         */
                        /* let's try to offer this slot to anybody */
                        if (may_dequeue_tasks(t->srv, t->be))
                              task_wakeup(t->srv->queue_mgt);

                        if (t->srv)
                              t->srv->failed_conns++;
                        t->be->failed_conns++;

                        t->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET);
                        t->srv = NULL; /* it's left to the dispatcher to choose a server */
                        http_flush_cookie_flags(txn);

                        /* first, get a connection */
                        if (srv_redispatch_connect(t))
                              return t->srv_state != SV_STIDLE;
                  }

                  do {
                        /* Now we will try to either reconnect to the same server or
                         * connect to another server. If the connection gets queued
                         * because all servers are saturated, then we will go back to
                         * the SV_STIDLE state.
                         */
                        if (srv_retryable_connect(t)) {
                              t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
                              return t->srv_state != SV_STCONN;
                        }

                        /* we need to redispatch the connection to another server */
                        if (srv_redispatch_connect(t))
                              return t->srv_state != SV_STCONN;
                  } while (1);
            }
            else { /* no error or write 0 */
                  t->logs.t_connect = tv_ms_elapsed(&t->logs.tv_accept, &now);

                  //fprintf(stderr,"3: c=%d, s=%d\n", c, s);
                  if (req->l == 0) /* nothing to write */ {
                        EV_FD_CLR(t->srv_fd, DIR_WR);
                        tv_eternity(&req->wex);
                  } else  /* need the right to write */ {
                        EV_FD_SET(t->srv_fd, DIR_WR);
                        if (tv_add_ifset(&req->wex, &now, &t->be->srvtimeout)) {
                              /* FIXME: to prevent the server from expiring read timeouts during writes,
                               * we refresh it. */
                              rep->rex = req->wex;
                        }
                        else
                              tv_eternity(&req->wex);
                  }

                  if (t->be->mode == PR_MODE_TCP) { /* let's allow immediate data connection in this case */
                        EV_FD_SET(t->srv_fd, DIR_RD);
                        if (!tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout))
                              tv_eternity(&rep->rex);
            
                        t->srv_state = SV_STDATA;
                        if (t->srv)
                              t->srv->cum_sess++;
                        rep->rlim = rep->data + BUFSIZE; /* no rewrite needed */

                        /* if the user wants to log as soon as possible, without counting
                           bytes from the server, then this is the right moment. */
                        if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
                              t->logs.t_close = t->logs.t_connect; /* to get a valid end date */
                              tcp_sess_log(t);
                        }
#ifdef CONFIG_HAP_TCPSPLICE
                        if ((t->fe->options & t->be->options) & PR_O_TCPSPLICE) {
                              /* TCP splicing supported by both FE and BE */
                              tcp_splice_splicefd(t->cli_fd, t->srv_fd, 0);
                        }
#endif
                  }
                  else {
                        t->srv_state = SV_STHEADERS;
                        if (t->srv)
                              t->srv->cum_sess++;
                        rep->rlim = rep->data + BUFSIZE - MAXREWRITE; /* rewrite needed */
                        t->txn.rsp.msg_state = HTTP_MSG_RPBEFORE;
                        /* reset hdr_idx which was already initialized by the request.
                         * right now, the http parser does it.
                         * hdr_idx_init(&t->txn.hdr_idx);
                         */
                  }
                  tv_eternity(&req->cex);
                  return 1;
            }
      }
      else if (s == SV_STHEADERS) { /* receiving server headers */
            /*
             * Now parse the partial (or complete) lines.
             * We will check the response syntax, and also join multi-line
             * headers. An index of all the lines will be elaborated while
             * parsing.
             *
             * For the parsing, we use a 28 states FSM.
             *
             * Here is the information we currently have :
             *   rep->data + req->som  = beginning of response
             *   rep->data + req->eoh  = end of processed headers / start of current one
             *   rep->data + req->eol  = end of current header or line (LF or CRLF)
             *   rep->lr = first non-visited byte
             *   rep->r  = end of data
             */

            int cur_idx;
            struct http_msg *msg = &txn->rsp;
            struct proxy *cur_proxy;

            if (likely(rep->lr < rep->r))
                  http_msg_analyzer(rep, msg, &txn->hdr_idx);

            /* 1: we might have to print this header in debug mode */
            if (unlikely((global.mode & MODE_DEBUG) &&
                       (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
                       (msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
                  char *eol, *sol;

                  sol = rep->data + msg->som;
                  eol = sol + msg->sl.rq.l;
                  debug_hdr("srvrep", t, sol, eol);

                  sol += hdr_idx_first_pos(&txn->hdr_idx);
                  cur_idx = hdr_idx_first_idx(&txn->hdr_idx);

                  while (cur_idx) {
                        eol = sol + txn->hdr_idx.v[cur_idx].len;
                        debug_hdr("srvhdr", t, sol, eol);
                        sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
                        cur_idx = txn->hdr_idx.v[cur_idx].next;
                  }
            }


            if ((rep->l < rep->rlim - rep->data) && EV_FD_COND_S(t->srv_fd, DIR_RD)) {
                  /* fd in DIR_RD was disabled, perhaps because of a previous buffer
                   * full. We cannot loop here since stream_sock_read will disable it only if
                   * rep->l == rlim-data
                   */
                  if (!tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout))
                        tv_eternity(&rep->rex);
            }


            /*
             * Now we quickly check if we have found a full valid response.
             * If not so, we check the FD and buffer states before leaving.
             * A full response is indicated by the fact that we have seen
             * the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
             * responses are checked first.
             *
             * Depending on whether the client is still there or not, we
             * may send an error response back or not. Note that normally
             * we should only check for HTTP status there, and check I/O
             * errors somewhere else.
             */

            if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {

                  /* Invalid response, or read error or write error */
                  if (unlikely((msg->msg_state == HTTP_MSG_ERROR) ||
                               (req->flags & BF_WRITE_ERROR) ||
                               (rep->flags & BF_READ_ERROR))) {
                        buffer_shutr(rep);
                        buffer_shutw(req);
                        fd_delete(t->srv_fd);
                        if (t->srv) {
                              t->srv->cur_sess--;
                              t->srv->failed_resp++;
                        }
                        t->be->failed_resp++;
                        t->srv_state = SV_STCLOSE;
                        txn->status = 502;
                        client_return(t, error_message(t, HTTP_ERR_502));
                        if (!(t->flags & SN_ERR_MASK))
                              t->flags |= SN_ERR_SRVCL;
                        if (!(t->flags & SN_FINST_MASK))
                              t->flags |= SN_FINST_H;
                        /* We used to have a free connection slot. Since we'll never use it,
                         * we have to inform the server that it may be used by another session.
                         */
                        if (t->srv && may_dequeue_tasks(t->srv, t->be))
                              task_wakeup(t->srv->queue_mgt);

                        return 1;
                  }

                  /* end of client write or end of server read.
                   * since we are in header mode, if there's no space left for headers, we
                   * won't be able to free more later, so the session will never terminate.
                   */
                  else if (unlikely(rep->flags & BF_READ_NULL ||
                                    c == CL_STSHUTW || c == CL_STCLOSE ||
                                    rep->l >= rep->rlim - rep->data)) {
                        EV_FD_CLR(t->srv_fd, DIR_RD);
                        buffer_shutr(rep);
                        t->srv_state = SV_STSHUTR;
                        //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
                        return 1;
                  }

                  /* read timeout : return a 504 to the client.
                   */
                  else if (unlikely(EV_FD_ISSET(t->srv_fd, DIR_RD) &&
                                    tv_isle(&rep->rex, &now))) {
                        buffer_shutr(rep);
                        buffer_shutw(req);
                        fd_delete(t->srv_fd);
                        if (t->srv) {
                              t->srv->cur_sess--;
                              t->srv->failed_resp++;
                        }
                        t->be->failed_resp++;
                        t->srv_state = SV_STCLOSE;
                        txn->status = 504;
                        client_return(t, error_message(t, HTTP_ERR_504));
                        if (!(t->flags & SN_ERR_MASK))
                              t->flags |= SN_ERR_SRVTO;
                        if (!(t->flags & SN_FINST_MASK))
                              t->flags |= SN_FINST_H;
                        /* We used to have a free connection slot. Since we'll never use it,
                         * we have to inform the server that it may be used by another session.
                         */
                        if (t->srv && may_dequeue_tasks(t->srv, t->be))
                              task_wakeup(t->srv->queue_mgt);
                        return 1;
                  }

                  /* last client read and buffer empty */
                  /* FIXME!!! here, we don't want to switch to SHUTW if the
                   * client shuts read too early, because we may still have
                   * some work to do on the headers.
                   * The side-effect is that if the client completely closes its
                   * connection during SV_STHEADER, the connection to the server
                   * is kept until a response comes back or the timeout is reached.
                   */
                  else if (unlikely((/*c == CL_STSHUTR ||*/ c == CL_STCLOSE) &&
                                    (req->l == 0))) {
                        EV_FD_CLR(t->srv_fd, DIR_WR);
                        buffer_shutw(req);

                        /* We must ensure that the read part is still
                         * alive when switching to shutw */
                        EV_FD_SET(t->srv_fd, DIR_RD);
                        tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout);

                        shutdown(t->srv_fd, SHUT_WR);
                        t->srv_state = SV_STSHUTW;
                        return 1;
                  }

                  /* write timeout */
                  /* FIXME!!! here, we don't want to switch to SHUTW if the
                   * client shuts read too early, because we may still have
                   * some work to do on the headers.
                   */
                  else if (unlikely(EV_FD_ISSET(t->srv_fd, DIR_WR) &&
                                tv_isle(&req->wex, &now))) {
                        EV_FD_CLR(t->srv_fd, DIR_WR);
                        buffer_shutw(req);
                        shutdown(t->srv_fd, SHUT_WR);
                        /* We must ensure that the read part is still alive
                         * when switching to shutw */
                        EV_FD_SET(t->srv_fd, DIR_RD);
                        tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout);

                        t->srv_state = SV_STSHUTW;
                        if (!(t->flags & SN_ERR_MASK))
                              t->flags |= SN_ERR_SRVTO;
                        if (!(t->flags & SN_FINST_MASK))
                              t->flags |= SN_FINST_H;
                        return 1;
                  }

                  /*
                   * And now the non-error cases.
                   */

                  /* Data remaining in the request buffer.
                   * This happens during the first pass here, and during
                   * long posts.
                   */
                  else if (likely(req->l)) {
                        if (EV_FD_COND_S(t->srv_fd, DIR_WR)) {
                              /* restart writing */
                              if (tv_add_ifset(&req->wex, &now, &t->be->srvtimeout)) {
                                    /* FIXME: to prevent the server from expiring read timeouts during writes,
                                     * we refresh it. */
                                    rep->rex = req->wex;
                              }
                              else
                                    tv_eternity(&req->wex);
                        }
                  }

                  /* nothing left in the request buffer */
                  else {
                        if (EV_FD_COND_C(t->srv_fd, DIR_WR)) {
                              /* stop writing */
                              tv_eternity(&req->wex);
                        }
                  }

                  return t->srv_state != SV_STHEADERS;
            }


            /*****************************************************************
             * More interesting part now : we know that we have a complete   *
             * response which at least looks like HTTP. We have an indicator *
             * of each header's length, so we can parse them quickly.        *
             ****************************************************************/

            /* ensure we keep this pointer to the beginning of the message */
            msg->sol = rep->data + msg->som;

            /*
             * 1: get the status code and check for cacheability.
             */

            t->logs.logwait &= ~LW_RESP;
            txn->status = strl2ui(rep->data + msg->sl.st.c, msg->sl.st.c_l);

            switch (txn->status) {
            case 200:
            case 203:
            case 206:
            case 300:
            case 301:
            case 410:
                  /* RFC2616 @13.4:
                   *   "A response received with a status code of
                   *    200, 203, 206, 300, 301 or 410 MAY be stored
                   *    by a cache (...) unless a cache-control
                   *    directive prohibits caching."
                   *   
                   * RFC2616 @9.5: POST method :
                   *   "Responses to this method are not cacheable,
                   *    unless the response includes appropriate
                   *    Cache-Control or Expires header fields."
                   */
                  if (likely(txn->meth != HTTP_METH_POST) &&
                      unlikely(t->be->options & PR_O_CHK_CACHE))
                        txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
                  break;
            default:
                  break;
            }

            /*
             * 2: we may need to capture headers
             */
            if (unlikely((t->logs.logwait & LW_RSPHDR) && t->fe->rsp_cap))
                  capture_headers(rep->data + msg->som, &txn->hdr_idx,
                              txn->rsp.cap, t->fe->rsp_cap);

            /*
             * 3: we will have to evaluate the filters.
             * As opposed to version 1.2, now they will be evaluated in the
             * filters order and not in the header order. This means that
             * each filter has to be validated among all headers.
             *
             * Filters are tried with ->be first, then with ->fe if it is
             * different from ->be.
             */

            t->flags &= ~SN_CONN_CLOSED; /* prepare for inspection */

            cur_proxy = t->be;
            while (1) {
                  struct proxy *rule_set = cur_proxy;

                  /* try headers filters */
                  if (rule_set->rsp_exp != NULL) {
                        if (apply_filters_to_response(t, rep, rule_set->rsp_exp) < 0) {
                        return_bad_resp:
                              if (t->srv) {
                                    t->srv->cur_sess--;
                                    t->srv->failed_resp++;
                              }
                              cur_proxy->failed_resp++;
                        return_srv_prx_502:
                              buffer_shutr(rep);
                              buffer_shutw(req);
                              fd_delete(t->srv_fd);
                              t->srv_state = SV_STCLOSE;
                              txn->status = 502;
                              client_return(t, error_message(t, HTTP_ERR_502));
                              if (!(t->flags & SN_ERR_MASK))
                                    t->flags |= SN_ERR_PRXCOND;
                              if (!(t->flags & SN_FINST_MASK))
                                    t->flags |= SN_FINST_H;
                              /* We used to have a free connection slot. Since we'll never use it,
                               * we have to inform the server that it may be used by another session.
                               */
                              if (t->srv && may_dequeue_tasks(t->srv, cur_proxy))
                                    task_wakeup(t->srv->queue_mgt);
                              return 1;
                        }
                  }

                  /* has the response been denied ? */
                  if (txn->flags & TX_SVDENY) {
                        if (t->srv) {
                              t->srv->cur_sess--;
                              t->srv->failed_secu++;
                        }
                        cur_proxy->denied_resp++;
                        goto return_srv_prx_502;
                  }

                  /* We might have to check for "Connection:" */
                  if (((t->fe->options | t->be->options) & PR_O_HTTP_CLOSE) &&
                      !(t->flags & SN_CONN_CLOSED)) {
                        char *cur_ptr, *cur_end, *cur_next;
                        int cur_idx, old_idx, delta, val;
                        struct hdr_idx_elem *cur_hdr;

                        cur_next = rep->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
                        old_idx = 0;

                        while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
                              cur_hdr  = &txn->hdr_idx.v[cur_idx];
                              cur_ptr  = cur_next;
                              cur_end  = cur_ptr + cur_hdr->len;
                              cur_next = cur_end + cur_hdr->cr + 1;

                              val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
                              if (val) {
                                    /* 3 possibilities :
                                     * - we have already set Connection: close,
                                     *   so we remove this line.
                                     * - we have not yet set Connection: close,
                                     *   but this line indicates close. We leave
                                     *   it untouched and set the flag.
                                     * - we have not yet set Connection: close,
                                     *   and this line indicates non-close. We
                                     *   replace it.
                                     */
                                    if (t->flags & SN_CONN_CLOSED) {
                                          delta = buffer_replace2(rep, cur_ptr, cur_next, NULL, 0);
                                          txn->rsp.eoh += delta;
                                          cur_next += delta;
                                          txn->hdr_idx.v[old_idx].next = cur_hdr->next;
                                          txn->hdr_idx.used--;
                                          cur_hdr->len = 0;
                                    } else {
                                          if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
                                                delta = buffer_replace2(rep, cur_ptr + val, cur_end,
                                                                  "close", 5);
                                                cur_next += delta;
                                                cur_hdr->len += delta;
                                                txn->rsp.eoh += delta;
                                          }
                                          t->flags |= SN_CONN_CLOSED;
                                    }
                              }
                              old_idx = cur_idx;
                        }
                  }

                  /* add response headers from the rule sets in the same order */
                  for (cur_idx = 0; cur_idx < rule_set->nb_rspadd; cur_idx++) {
                        if (unlikely(http_header_add_tail(rep, &txn->rsp, &txn->hdr_idx,
                                                  rule_set->rsp_add[cur_idx])) < 0)
                              goto return_bad_resp;
                  }

                  /* check whether we're already working on the frontend */
                  if (cur_proxy == t->fe)
                        break;
                  cur_proxy = t->fe;
            }

            /*
             * 4: check for server cookie.
             */
            manage_server_side_cookies(t, rep);

            /*
             * 5: add server cookie in the response if needed
             */
            if ((t->srv) && !(t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_INS) &&
                (!(t->be->options & PR_O_COOK_POST) || (txn->meth == HTTP_METH_POST))) {
                  int len;

                  /* the server is known, it's not the one the client requested, we have to
                   * insert a set-cookie here, except if we want to insert only on POST
                   * requests and this one isn't. Note that servers which don't have cookies
                   * (eg: some backup servers) will return a full cookie removal request.
                   */
                  len = sprintf(trash, "Set-Cookie: %s=%s; path=/",
                              t->be->cookie_name,
                              t->srv->cookie ? t->srv->cookie : "; Expires=Thu, 01-Jan-1970 00:00:01 GMT");

                  if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
                                             trash, len)) < 0)
                        goto return_bad_resp;
                  txn->flags |= TX_SCK_INSERTED;

                  /* Here, we will tell an eventual cache on the client side that we don't
                   * want it to cache this reply because HTTP/1.0 caches also cache cookies !
                   * Some caches understand the correct form: 'no-cache="set-cookie"', but
                   * others don't (eg: apache <= 1.3.26). So we use 'private' instead.
                   */
                  if (t->be->options & PR_O_COOK_NOC) {
                        if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
                                                   "Cache-control: private", 22)) < 0)
                              goto return_bad_resp;
                  }
            }


            /*
             * 6: check for cache-control or pragma headers.
             */
            check_response_for_cacheability(t, rep);


            /*
             * 7: check if result will be cacheable with a cookie.
             * We'll block the response if security checks have caught
             * nasty things such as a cacheable cookie.
             */
            if (((txn->flags & (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) ==
                 (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) &&
                (t->be->options & PR_O_CHK_CACHE)) {

                  /* we're in presence of a cacheable response containing
                   * a set-cookie header. We'll block it as requested by
                   * the 'checkcache' option, and send an alert.
                   */
                  if (t->srv) {
                        t->srv->cur_sess--;
                        t->srv->failed_secu++;
                  }
                  t->be->denied_resp++;

                  Alert("Blocking cacheable cookie in response from instance %s, server %s.\n",
                        t->be->id, t->srv?t->srv->id:"<dispatch>");
                  send_log(t->be, LOG_ALERT,
                         "Blocking cacheable cookie in response from instance %s, server %s.\n",
                         t->be->id, t->srv?t->srv->id:"<dispatch>");
                  goto return_srv_prx_502;
            }

            /*
             * 8: add "Connection: close" if needed and not yet set.
             * Note that we do not need to add it in case of HTTP/1.0.
             */
            if (!(t->flags & SN_CONN_CLOSED) &&
                ((t->fe->options | t->be->options) & PR_O_HTTP_CLOSE)) {
                  if ((unlikely(msg->sl.st.v_l != 8) ||
                       unlikely(req->data[msg->som + 7] != '0')) &&
                      unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
                                             "Connection: close", 17)) < 0)
                        goto return_bad_resp;
                  t->flags |= SN_CONN_CLOSED;
            }


            /*************************************************************
             * OK, that's finished for the headers. We have done what we *
             * could. Let's switch to the DATA state.                    *
             ************************************************************/

            t->srv_state = SV_STDATA;
            rep->rlim = rep->data + BUFSIZE; /* no more rewrite needed */
            t->logs.t_data = tv_ms_elapsed(&t->logs.tv_accept, &now);

            /* client connection already closed or option 'forceclose' required :
             * we close the server's outgoing connection right now.
             */
            if ((req->l == 0) &&
                (c == CL_STSHUTR || c == CL_STCLOSE || t->be->options & PR_O_FORCE_CLO)) {
                  EV_FD_CLR(t->srv_fd, DIR_WR);
                  buffer_shutw(req);

                  /* We must ensure that the read part is still alive when switching
                   * to shutw */
                  EV_FD_SET(t->srv_fd, DIR_RD);
                  tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout);

                  shutdown(t->srv_fd, SHUT_WR);
                  t->srv_state = SV_STSHUTW;
            }

#ifdef CONFIG_HAP_TCPSPLICE
            if ((t->fe->options & t->be->options) & PR_O_TCPSPLICE) {
                  /* TCP splicing supported by both FE and BE */
                  tcp_splice_splicefd(t->cli_fd, t->srv_fd, 0);
            }
#endif
            /* if the user wants to log as soon as possible, without counting
               bytes from the server, then this is the right moment. */
            if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
                  t->logs.t_close = t->logs.t_data; /* to get a valid end date */
                  t->logs.bytes_in = txn->rsp.eoh;
                  if (t->fe->to_log & LW_REQ)
                        http_sess_log(t);
                  else
                        tcp_sess_log(t);
            }

            /* Note: we must not try to cheat by jumping directly to DATA,
             * otherwise we would not let the client side wake up.
             */

            return 1;
      }
      else if (s == SV_STDATA) {
            /* read or write error */
            if (req->flags & BF_WRITE_ERROR || rep->flags & BF_READ_ERROR) {
                  buffer_shutr(rep);
                  buffer_shutw(req);
                  fd_delete(t->srv_fd);
                  if (t->srv) {
                        t->srv->cur_sess--;
                        t->srv->failed_resp++;
                  }
                  t->be->failed_resp++;
                  t->srv_state = SV_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_SRVCL;
                  if (!(t->flags & SN_FINST_MASK))
                        t->flags |= SN_FINST_D;
                  /* We used to have a free connection slot. Since we'll never use it,
                   * we have to inform the server that it may be used by another session.
                   */
                  if (may_dequeue_tasks(t->srv, t->be))
                        task_wakeup(t->srv->queue_mgt);

                  return 1;
            }
            /* last read, or end of client write */
            else if (rep->flags & BF_READ_NULL || c == CL_STSHUTW || c == CL_STCLOSE) {
                  EV_FD_CLR(t->srv_fd, DIR_RD);
                  buffer_shutr(rep);
                  t->srv_state = SV_STSHUTR;
                  //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
                  return 1;
            }
            /* end of client read and no more data to send */
            else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) {
                  EV_FD_CLR(t->srv_fd, DIR_WR);
                  buffer_shutw(req);
                  shutdown(t->srv_fd, SHUT_WR);
                  /* We must ensure that the read part is still alive when switching
                   * to shutw */
                  EV_FD_SET(t->srv_fd, DIR_RD);
                  tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout);

                  t->srv_state = SV_STSHUTW;
                  return 1;
            }
            /* read timeout */
            else if (tv_isle(&rep->rex, &now)) {
                  EV_FD_CLR(t->srv_fd, DIR_RD);
                  buffer_shutr(rep);
                  t->srv_state = SV_STSHUTR;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_SRVTO;
                  if (!(t->flags & SN_FINST_MASK))
                        t->flags |= SN_FINST_D;
                  return 1;
            }     
            /* write timeout */
            else if (tv_isle(&req->wex, &now)) {
                  EV_FD_CLR(t->srv_fd, DIR_WR);
                  buffer_shutw(req);
                  shutdown(t->srv_fd, SHUT_WR);
                  /* We must ensure that the read part is still alive when switching
                   * to shutw */
                  EV_FD_SET(t->srv_fd, DIR_RD);
                  tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout);
                  t->srv_state = SV_STSHUTW;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_SRVTO;
                  if (!(t->flags & SN_FINST_MASK))
                        t->flags |= SN_FINST_D;
                  return 1;
            }

            /* recompute request time-outs */
            if (req->l == 0) {
                  if (EV_FD_COND_C(t->srv_fd, DIR_WR)) {
                        /* stop writing */
                        tv_eternity(&req->wex);
                  }
            }
            else { /* buffer not empty, there are still data to be transferred */
                  if (EV_FD_COND_S(t->srv_fd, DIR_WR)) {
                        /* restart writing */
                        if (tv_add_ifset(&req->wex, &now, &t->be->srvtimeout)) {
                              /* FIXME: to prevent the server from expiring read timeouts during writes,
                               * we refresh it. */
                              rep->rex = req->wex;
                        }
                        else
                              tv_eternity(&req->wex);
                  }
            }

            /* recompute response time-outs */
            if (rep->l == BUFSIZE) { /* no room to read more data */
                  if (EV_FD_COND_C(t->srv_fd, DIR_RD)) {
                        tv_eternity(&rep->rex);
                  }
            }
            else {
                  if (EV_FD_COND_S(t->srv_fd, DIR_RD)) {
                        if (!tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout))
                              tv_eternity(&rep->rex);
                  }
            }

            return 0; /* other cases change nothing */
      }
      else if (s == SV_STSHUTR) {
            if (req->flags & BF_WRITE_ERROR) {
                  //EV_FD_CLR(t->srv_fd, DIR_WR);
                  buffer_shutw(req);
                  fd_delete(t->srv_fd);
                  if (t->srv) {
                        t->srv->cur_sess--;
                        t->srv->failed_resp++;
                  }
                  t->be->failed_resp++;
                  //close(t->srv_fd);
                  t->srv_state = SV_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_SRVCL;
                  if (!(t->flags & SN_FINST_MASK))
                        t->flags |= SN_FINST_D;
                  /* We used to have a free connection slot. Since we'll never use it,
                   * we have to inform the server that it may be used by another session.
                   */
                  if (may_dequeue_tasks(t->srv, t->be))
                        task_wakeup(t->srv->queue_mgt);

                  return 1;
            }
            else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) {
                  //EV_FD_CLR(t->srv_fd, DIR_WR);
                  buffer_shutw(req);
                  fd_delete(t->srv_fd);
                  if (t->srv)
                        t->srv->cur_sess--;
                  //close(t->srv_fd);
                  t->srv_state = SV_STCLOSE;
                  /* We used to have a free connection slot. Since we'll never use it,
                   * we have to inform the server that it may be used by another session.
                   */
                  if (may_dequeue_tasks(t->srv, t->be))
                        task_wakeup(t->srv->queue_mgt);

                  return 1;
            }
            else if (tv_isle(&req->wex, &now)) {
                  //EV_FD_CLR(t->srv_fd, DIR_WR);
                  buffer_shutw(req);
                  fd_delete(t->srv_fd);
                  if (t->srv)
                        t->srv->cur_sess--;
                  //close(t->srv_fd);
                  t->srv_state = SV_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_SRVTO;
                  if (!(t->flags & SN_FINST_MASK))
                        t->flags |= SN_FINST_D;
                  /* We used to have a free connection slot. Since we'll never use it,
                   * we have to inform the server that it may be used by another session.
                   */
                  if (may_dequeue_tasks(t->srv, t->be))
                        task_wakeup(t->srv->queue_mgt);

                  return 1;
            }
            else if (req->l == 0) {
                  if (EV_FD_COND_C(t->srv_fd, DIR_WR)) {
                        /* stop writing */
                        tv_eternity(&req->wex);
                  }
            }
            else { /* buffer not empty */
                  if (EV_FD_COND_S(t->srv_fd, DIR_WR)) {
                        /* restart writing */
                        if (!tv_add_ifset(&req->wex, &now, &t->be->srvtimeout))
                              tv_eternity(&req->wex);
                  }
            }
            return 0;
      }
      else if (s == SV_STSHUTW) {
            if (rep->flags & BF_READ_ERROR) {
                  //EV_FD_CLR(t->srv_fd, DIR_RD);
                  buffer_shutr(rep);
                  fd_delete(t->srv_fd);
                  if (t->srv) {
                        t->srv->cur_sess--;
                        t->srv->failed_resp++;
                  }
                  t->be->failed_resp++;
                  //close(t->srv_fd);
                  t->srv_state = SV_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_SRVCL;
                  if (!(t->flags & SN_FINST_MASK))
                        t->flags |= SN_FINST_D;
                  /* We used to have a free connection slot. Since we'll never use it,
                   * we have to inform the server that it may be used by another session.
                   */
                  if (may_dequeue_tasks(t->srv, t->be))
                        task_wakeup(t->srv->queue_mgt);

                  return 1;
            }
            else if (rep->flags & BF_READ_NULL || c == CL_STSHUTW || c == CL_STCLOSE) {
                  //EV_FD_CLR(t->srv_fd, DIR_RD);
                  buffer_shutr(rep);
                  fd_delete(t->srv_fd);
                  if (t->srv)
                        t->srv->cur_sess--;
                  //close(t->srv_fd);
                  t->srv_state = SV_STCLOSE;
                  /* We used to have a free connection slot. Since we'll never use it,
                   * we have to inform the server that it may be used by another session.
                   */
                  if (may_dequeue_tasks(t->srv, t->be))
                        task_wakeup(t->srv->queue_mgt);

                  return 1;
            }
            else if (tv_isle(&rep->rex, &now)) {
                  //EV_FD_CLR(t->srv_fd, DIR_RD);
                  buffer_shutr(rep);
                  fd_delete(t->srv_fd);
                  if (t->srv)
                        t->srv->cur_sess--;
                  //close(t->srv_fd);
                  t->srv_state = SV_STCLOSE;
                  if (!(t->flags & SN_ERR_MASK))
                        t->flags |= SN_ERR_SRVTO;
                  if (!(t->flags & SN_FINST_MASK))
                        t->flags |= SN_FINST_D;
                  /* We used to have a free connection slot. Since we'll never use it,
                   * we have to inform the server that it may be used by another session.
                   */
                  if (may_dequeue_tasks(t->srv, t->be))
                        task_wakeup(t->srv->queue_mgt);

                  return 1;
            }
            else if (rep->l == BUFSIZE) { /* no room to read more data */
                  if (EV_FD_COND_C(t->srv_fd, DIR_RD)) {
                        tv_eternity(&rep->rex);
                  }
            }
            else {
                  if (EV_FD_COND_S(t->srv_fd, DIR_RD)) {
                        if (!tv_add_ifset(&rep->rex, &now, &t->be->srvtimeout))
                              tv_eternity(&rep->rex);
                  }
            }
            return 0;
      }
      else { /* SV_STCLOSE : nothing to do */
            if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
                  int len;
                  len = sprintf(trash, "%08x:%s.srvcls[%04x:%04x]\n",
                              t->uniq_id, t->be->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
                  write(1, trash, len);
            }
            return 0;
      }
      return 0;
}


/*
 * Produces data for the session <s> depending on its source. Expects to be
 * called with s->cli_state == CL_STSHUTR. Right now, only statistics can be
 * produced. It stops by itself by unsetting the SN_SELF_GEN flag from the
 * session, which it uses to keep on being called when there is free space in
 * the buffer, of simply by letting an empty buffer upon return. It returns 1
 * if it changes the session state from CL_STSHUTR, otherwise 0.
 */
int produce_content(struct session *s)
{
      if (s->data_source == DATA_SRC_NONE) {
            s->flags &= ~SN_SELF_GEN;
            return 1;
      }
      else if (s->data_source == DATA_SRC_STATS) {
            /* dump server statistics */
            return produce_content_stats(s);
      }
      else {
            /* unknown data source */
            s->txn.status = 500;
            client_retnclose(s, error_message(s, HTTP_ERR_500));
            if (!(s->flags & SN_ERR_MASK))
                  s->flags |= SN_ERR_PRXCOND;
            if (!(s->flags & SN_FINST_MASK))
                  s->flags |= SN_FINST_R;
            s->flags &= ~SN_SELF_GEN;
            return 1;
      }
}


/*
 * Produces statistics data for the session <s>. Expects to be called with
 * s->cli_state == CL_STSHUTR. It stops by itself by unsetting the SN_SELF_GEN
 * flag from the session, which it uses to keep on being called when there is
 * free space in the buffer, of simply by letting an empty buffer upon return.
 * It returns 1 if it changes the session state from CL_STSHUTR, otherwise 0.
 */
int produce_content_stats(struct session *s)
{
      struct buffer *rep = s->rep;
      struct proxy *px;
      struct chunk msg;
      unsigned int up;

      msg.len = 0;
      msg.str = trash;

      switch (s->data_state) {
      case DATA_ST_INIT:
            /* the function had not been called yet */
            s->flags |= SN_SELF_GEN;  // more data will follow

            chunk_printf(&msg, sizeof(trash),
                       "HTTP/1.0 200 OK\r\n"
                       "Cache-Control: no-cache\r\n"
                       "Connection: close\r\n"
                       "Content-Type: text/html\r\n"
                       "\r\n");

            s->txn.status = 200;
            client_retnclose(s, &msg); // send the start of the response.
            msg.len = 0;

            if (!(s->flags & SN_ERR_MASK))  // this is not really an error but it is
                  s->flags |= SN_ERR_PRXCOND; // to mark that it comes from the proxy
            if (!(s->flags & SN_FINST_MASK))
                  s->flags |= SN_FINST_R;

            if (s->txn.meth == HTTP_METH_HEAD) {
                  /* that's all we return in case of HEAD request */
                  s->data_state = DATA_ST_FIN;
                  s->flags &= ~SN_SELF_GEN;
                  return 1;
            }

            s->data_state = DATA_ST_HEAD; /* let's start producing data */
            /* fall through */

      case DATA_ST_HEAD:
            /* WARNING! This must fit in the first buffer !!! */      
            chunk_printf(&msg, sizeof(trash),
                       "<html><head><title>Statistics Report for " PRODUCT_NAME "</title>\n"
                       "<meta http-equiv=\"content-type\" content=\"text/html; charset=iso-8859-1\">\n"
                       "<style type=\"text/css\"><!--\n"
                       "body {"
                       " font-family: helvetica, arial;"
                       " font-size: 12px;"
                       " font-weight: normal;"
                       " color: black;"
                       " background: white;"
                       "}\n"
                       "th,td {"
                       " font-size: 0.8em;"
                       " align: center;"
                       "}\n"
                       "h1 {"
                       " font-size: xx-large;"
                       " margin-bottom: 0.5em;"
                       "}\n"
                       "h2 {"
                       " font-family: helvetica, arial;"
                       " font-size: x-large;"
                       " font-weight: bold;"
                       " font-style: italic;"
                       " color: #6020a0;"
                       " margin-top: 0em;"
                       " margin-bottom: 0em;"
                       "}\n"
                       "h3 {"
                       " font-family: helvetica, arial;"
                       " font-size: 16px;"
                       " font-weight: bold;"
                       " color: #b00040;"
                       " background: #e8e8d0;"
                       " margin-top: 0em;"
                       " margin-bottom: 0em;"
                       "}\n"
                       "li {"
                       " margin-top: 0.25em;"
                       " margin-right: 2em;"
                       "}\n"
                       ".hr {margin-top: 0.25em;"
                       " border-color: black;"
                       " border-bottom-style: solid;"
                       "}\n"
                       ".pxname     {background: #b00040;color: #ffff40;font-weight: bold;}\n"
                       ".titre      {background: #20D0D0;color: #000000;font-weight: bold;}\n"
                       ".total      {background: #20D0D0;color: #ffff80;}\n"
                       ".frontend   {background: #e8e8d0;}\n"
                       ".backend    {background: #e8e8d0;}\n"
                       ".active0    {background: #ff9090;}\n"
                       ".active1    {background: #ffd020;}\n"
                       ".active2    {background: #ffffa0;}\n"
                       ".active3    {background: #c0ffc0;}\n"
                       ".active4    {background: #e0e0e0;}\n"
                       ".backup0    {background: #ff9090;}\n"
                       ".backup1    {background: #ff80ff;}\n"
                       ".backup2    {background: #c060ff;}\n"
                       ".backup3    {background: #b0d0ff;}\n"
                       ".backup4    {background: #e0e0e0;}\n"
                       "table.tbl { border-collapse: collapse; border-style: none;}\n"
                       "table.tbl td { border-width: 1px 1px 1px 1px; border-style: solid solid solid solid; padding: 2px 3px; border-color: gray;}\n"
                       "table.tbl th { border-width: 1px; border-style: solid solid solid solid; border-color: gray;}\n"
                       "table.tbl th.empty { border-style: none; empty-cells: hide;}\n"
                       "table.lgd { border-collapse: collapse; border-width: 1px; border-style: none none none solid; border-color: black;}\n"
                       "table.lgd td { border-width: 1px; border-style: solid solid solid solid; border-color: gray; padding: 2px;}\n"
                       "table.lgd td.noborder { border-style: none; padding: 2px; white-space: nowrap;}\n"
                       "-->\n"
                       "</style></head>\n");
                  
            if (buffer_write_chunk(rep, &msg) != 0)
                  return 0;

            s->data_state = DATA_ST_INFO;
            /* fall through */

      case DATA_ST_INFO:
            up = (now.tv_sec - start_date.tv_sec);

            /* WARNING! this has to fit the first packet too.
                   * We are around 3.5 kB, add adding entries will
                   * become tricky if we want to support 4kB buffers !
                   */
            chunk_printf(&msg, sizeof(trash),
                       "<body><h1><a href=\"" PRODUCT_URL "\" style=\"text-decoration: none;\">"
                       PRODUCT_NAME "</a></h1>\n"
                       "<h2>Statistics Report for pid %d</h2>\n"
                       "<hr width=\"100%%\" class=\"hr\">\n"
                       "<h3>&gt; General process information</h3>\n"
                       "<table border=0 cols=3><tr><td align=\"left\" nowrap width=\"1%%\">\n"
                       "<p><b>pid = </b> %d (nbproc = %d)<br>\n"
                       "<b>uptime = </b> %dd %dh%02dm%02ds<br>\n"
                       "<b>system limits :</b> memmax = %s%s ; ulimit-n = %d<br>\n"
                       "<b>maxsock = </b> %d<br>\n"
                       "<b>maxconn = </b> %d (current conns = %d)<br>\n"
                       "</td><td align=\"center\" nowrap>\n"
                       "<table class=\"lgd\"><tr>\n"
                       "<td class=\"active3\">&nbsp;</td><td class=\"noborder\">active UP </td>"
                       "<td class=\"backup3\">&nbsp;</td><td class=\"noborder\">backup UP </td>"
                       "</tr><tr>\n"
                       "<td class=\"active2\"></td><td class=\"noborder\">active UP, going down </td>"
                       "<td class=\"backup2\"></td><td class=\"noborder\">backup UP, going down </td>"
                       "</tr><tr>\n"
                       "<td class=\"active1\"></td><td class=\"noborder\">active DOWN, going up </td>"
                       "<td class=\"backup1\"></td><td class=\"noborder\">backup DOWN, going up </td>"
                       "</tr><tr>\n"
                       "<td class=\"active0\"></td><td class=\"noborder\">active or backup DOWN &nbsp;</td>"
                       "<td class=\"active4\"></td><td class=\"noborder\">not checked </td>"
                       "</tr></table>\n"
                       "</td>"
                       "<td align=\"left\" nowrap width=\"1%%\">"
                       "<b>External ressources:</b><ul style=\"margin-top: 0.25em;\">\n"
                       "<li><a href=\"" PRODUCT_URL "\">Primary site</a><br>\n"
                       "<li><a href=\"" PRODUCT_URL_UPD "\">Updates (v" PRODUCT_BRANCH ")</a><br>\n"
                       "<li><a href=\"" PRODUCT_URL_DOC "\">Online manual</a><br>\n"
                       "</ul>"
                       "</td>"
                       "</tr></table>\n"
                       "",
                       pid, pid, global.nbproc,
                       up / 86400, (up % 86400) / 3600,
                       (up % 3600) / 60, (up % 60),
                       global.rlimit_memmax ? ultoa(global.rlimit_memmax) : "unlimited",
                       global.rlimit_memmax ? " MB" : "",
                       global.rlimit_nofile,
                       global.maxsock,
                       global.maxconn,
                       actconn
                       );
          
            if (buffer_write_chunk(rep, &msg) != 0)
                  return 0;

            memset(&s->data_ctx, 0, sizeof(s->data_ctx));

            s->data_ctx.stats.px = proxy;
            s->data_ctx.stats.px_st = DATA_ST_PX_INIT;
            s->data_state = DATA_ST_LIST;
            /* fall through */

      case DATA_ST_LIST:
            /* dump proxies */
            while (s->data_ctx.stats.px) {
                  px = s->data_ctx.stats.px;
                  /* skip the disabled proxies and non-networked ones */
                  if (px->state != PR_STSTOPPED && (px->cap & (PR_CAP_FE | PR_CAP_BE)))
                        if (produce_content_stats_proxy(s, px) == 0)
                              return 0;

                  s->data_ctx.stats.px = px->next;
                  s->data_ctx.stats.px_st = DATA_ST_PX_INIT;
            }
            /* here, we just have reached the last proxy */

            s->data_state = DATA_ST_END;
            /* fall through */

      case DATA_ST_END:
            chunk_printf(&msg, sizeof(trash), "</body></html>\n");
            if (buffer_write_chunk(rep, &msg) != 0)
                  return 0;

            s->data_state = DATA_ST_FIN;
            /* fall through */

      case DATA_ST_FIN:
            s->flags &= ~SN_SELF_GEN;
            return 1;

      default:
            /* unknown state ! */
            s->txn.status = 500;
            client_retnclose(s, error_message(s, HTTP_ERR_500));
            if (!(s->flags & SN_ERR_MASK))
                  s->flags |= SN_ERR_PRXCOND;
            if (!(s->flags & SN_FINST_MASK))
                  s->flags |= SN_FINST_R;
            s->flags &= ~SN_SELF_GEN;
            return 1;
      }
}


/*
 * Dumps statistics for a proxy.
 * Returns 0 if it had to stop dumping data because of lack of buffer space,
 * ot non-zero if everything completed.
 */
int produce_content_stats_proxy(struct session *s, struct proxy *px)
{
      struct buffer *rep = s->rep;
      struct server *sv;
      struct chunk msg;

      msg.len = 0;
      msg.str = trash;

      switch (s->data_ctx.stats.px_st) {
      case DATA_ST_PX_INIT:
            /* we are on a new proxy */

            if (s->be->uri_auth && s->be->uri_auth->scope) {
                  /* we have a limited scope, we have to check the proxy name */
                  struct stat_scope *scope;
                  int len;

                  len = strlen(px->id);
                  scope = s->be->uri_auth->scope;

                  while (scope) {
                        /* match exact proxy name */
                        if (scope->px_len == len && !memcmp(px->id, scope->px_id, len))
                              break;

                        /* match '.' which means 'self' proxy */
                        if (!strcmp(scope->px_id, ".") && px == s->fe)
                              break;
                        scope = scope->next;
                  }

                  /* proxy name not found : don't dump anything */
                  if (scope == NULL)
                        return 1;
            }

            s->data_ctx.stats.px_st = DATA_ST_PX_TH;
            /* fall through */

      case DATA_ST_PX_TH:
            /* print a new table */
            chunk_printf(&msg, sizeof(trash),
                       "<table cols=\"20\" class=\"tbl\" width=\"100%%\">\n"
                       "<tr align=\"center\" class=\"titre\">"
                       "<th colspan=2 class=\"pxname\">%s</th>"
                       "<th colspan=18 class=\"empty\"></th>"
                       "</tr>\n"
                       "<tr align=\"center\" class=\"titre\">"
                       "<th rowspan=2></th>"
                       "<th colspan=2>Queue</th><th colspan=4>Sessions</th>"
                       "<th colspan=2>Bytes</th><th colspan=2>Denied</th>"
                       "<th colspan=3>Errors</th><th colspan=6>Server</th>"
                       "</tr>\n"
                       "<tr align=\"center\" class=\"titre\">"
                       "<th>Cur</th><th>Max</th><th>Cur</th><th>Max</th>"
                       "<th>Limit</th><th>Cumul</th><th>In</th><th>Out</th>"
                       "<th>Req</th><th>Resp</th><th>Req</th><th>Conn</th>"
                       "<th>Resp</th><th>Status</th><th>Weight</th><th>Act</th>"
                       "<th>Bck</th><th>Check</th><th>Down</th></tr>\n"
                       "",
                       px->id);
            
            if (buffer_write_chunk(rep, &msg) != 0)
                  return 0;

            s->data_ctx.stats.px_st = DATA_ST_PX_FE;
            /* fall through */

      case DATA_ST_PX_FE:
            /* print the frontend */
            if (px->cap & PR_CAP_FE) {
                  chunk_printf(&msg, sizeof(trash),
                             /* name, queue */
                             "<tr align=center class=\"frontend\"><td>Frontend</td><td colspan=2></td>"
                             /* sessions : current, max, limit, cumul. */
                             "<td align=right>%d</td><td align=right>%d</td><td align=right>%d</td><td align=right>%d</td>"
                             /* bytes : in, out */
                             "<td align=right>%lld</td><td align=right>%lld</td>"
                             /* denied: req, resp */
                             "<td align=right>%d</td><td align=right>%d</td>"
                             /* errors : request, connect, response */
                             "<td align=right>%d</td><td align=right></td><td align=right></td>"
                             /* server status : reflect backend status */
                             "<td align=center>%s</td>"
                             /* rest of server: nothing */
                             "<td align=center colspan=5></td></tr>"
                             "",
                             px->feconn, px->feconn_max, px->maxconn, px->cum_feconn,
                             px->bytes_in, px->bytes_out,
                             px->denied_req, px->denied_resp,
                             px->failed_req,
                             px->state == PR_STRUN ? "OPEN" :
                             px->state == PR_STIDLE ? "FULL" : "STOP");

                  if (buffer_write_chunk(rep, &msg) != 0)
                        return 0;
            }

            s->data_ctx.stats.sv = px->srv; /* may be NULL */
            s->data_ctx.stats.px_st = DATA_ST_PX_SV;
            /* fall through */

      case DATA_ST_PX_SV:
            /* stats.sv has been initialized above */
            while (s->data_ctx.stats.sv != NULL) {
                  static char *srv_hlt_st[5] = { "DOWN", "DN %d/%d &uarr;", "UP %d/%d &darr;", "UP", "<i>no check</i>" };
                  int sv_state; /* 0=DOWN, 1=going up, 2=going down, 3=UP, 4=unchecked */

                  sv = s->data_ctx.stats.sv;

                  /* FIXME: produce some small strings for "UP/DOWN x/y &#xxxx;" */
                  if (!(sv->state & SRV_CHECKED))
                        sv_state = 4;
                  else if (sv->state & SRV_RUNNING)
                        if (sv->health == sv->rise + sv->fall - 1)
                              sv_state = 3; /* UP */
                        else
                              sv_state = 2; /* going down */
                  else
                        if (sv->health)
                              sv_state = 1; /* going up */
                        else
                              sv_state = 0; /* DOWN */

                  chunk_printf(&msg, sizeof(trash),
                             /* name */
                             "<tr align=\"center\" class=\"%s%d\"><td>%s</td>"
                             /* queue : current, max */
                             "<td align=right>%d</td><td align=right>%d</td>"
                             /* sessions : current, max, limit, cumul */
                             "<td align=right>%d</td><td align=right>%d</td><td align=right>%s</td><td align=right>%d</td>"
                             /* bytes : in, out */
                             "<td align=right>%lld</td><td align=right>%lld</td>"
                             /* denied: req, resp */
                             "<td align=right></td><td align=right>%d</td>"
                             /* errors : request, connect, response */
                             "<td align=right></td><td align=right>%d</td><td align=right>%d</td>\n"
                             "",
                             (sv->state & SRV_BACKUP) ? "backup" : "active",
                             sv_state, sv->id,
                             sv->nbpend, sv->nbpend_max,
                             sv->cur_sess, sv->cur_sess_max, sv->maxconn ? ultoa(sv->maxconn) : "-", sv->cum_sess,
                             sv->bytes_in, sv->bytes_out,
                             sv->failed_secu,
                             sv->failed_conns, sv->failed_resp);
                             
                  /* status */
                  chunk_printf(&msg, sizeof(trash), "<td nowrap>");
                  chunk_printf(&msg, sizeof(trash),
                             srv_hlt_st[sv_state],
                             (sv->state & SRV_RUNNING) ? (sv->health - sv->rise + 1) : (sv->health),
                             (sv->state & SRV_RUNNING) ? (sv->fall) : (sv->rise));

                  chunk_printf(&msg, sizeof(trash),
                             /* weight */
                             "</td><td>%d</td>"
                             /* act, bck */
                             "<td>%s</td><td>%s</td>"
                             "",
                             sv->uweight,
                             (sv->state & SRV_BACKUP) ? "-" : "Y",
                             (sv->state & SRV_BACKUP) ? "Y" : "-");

                  /* check failures : unique, fatal */
                  if (sv->state & SRV_CHECKED)
                        chunk_printf(&msg, sizeof(trash),
                                   "<td align=right>%d</td><td align=right>%d</td></tr>\n",
                                   sv->failed_checks, sv->down_trans);
                  else
                        chunk_printf(&msg, sizeof(trash),
                                   "<td colspan=2></td></tr>\n");

                  if (buffer_write_chunk(rep, &msg) != 0)
                        return 0;

                  s->data_ctx.stats.sv = sv->next;
            } /* while sv */

            s->data_ctx.stats.px_st = DATA_ST_PX_BE;
            /* fall through */

      case DATA_ST_PX_BE:
            /* print the backend */
            if (px->cap & PR_CAP_BE) {
                  chunk_printf(&msg, sizeof(trash),
                             /* name */
                             "<tr align=center class=\"backend\"><td>Backend</td>"
                             /* queue : current, max */
                             "<td align=right>%d</td><td align=right>%d</td>"
                             /* sessions : current, max, limit, cumul. */
                             "<td align=right>%d</td><td align=right>%d</td><td align=right>%d</td><td align=right>%d</td>"
                             /* bytes : in, out */
                             "<td align=right>%lld</td><td align=right>%lld</td>"
                             /* denied: req, resp */
                             "<td align=right>%d</td><td align=right>%d</td>"
                             /* errors : request, connect, response */
                             "<td align=right></td><td align=right>%d</td><td align=right>%d</td>\n"
                             /* server status : reflect backend status (up/down) : we display UP
                              * if the backend has known working servers or if it has no server at
                              * all (eg: for stats). Tthen we display the total weight, number of
                              * active and backups. */
                             "<td align=center>%s</td><td align=center>%d</td>"
                             "<td align=center>%d</td><td align=center>%d</td>"
                             /* rest of server: nothing */
                             "<td align=center colspan=2></td></tr>"
                             "",
                             px->nbpend /* or px->totpend ? */, px->nbpend_max,
                             px->beconn, px->beconn_max, px->fullconn, px->cum_beconn,
                             px->bytes_in, px->bytes_out,
                             px->denied_req, px->denied_resp,
                             px->failed_conns, px->failed_resp,
                             (px->srv_map_sz > 0 || !px->srv) ? "UP" : "DOWN",
                             px->srv_map_sz, px->srv_act, px->srv_bck);

                  if (buffer_write_chunk(rep, &msg) != 0)
                        return 0;
            }
            
            s->data_ctx.stats.px_st = DATA_ST_PX_END;
            /* fall through */

      case DATA_ST_PX_END:
            chunk_printf(&msg, sizeof(trash), "</table><p>\n");

            if (buffer_write_chunk(rep, &msg) != 0)
                  return 0;

            s->data_ctx.stats.px_st = DATA_ST_PX_FIN;
            /* fall through */

      case DATA_ST_PX_FIN:
            return 1;

      default:
            /* unknown state, we should put an abort() here ! */
            return 1;
      }
}


/* Iterate the same filter through all request headers.
 * Returns 1 if this filter can be stopped upon return, otherwise 0.
 * Since it can manage the switch to another backend, it updates the per-proxy
 * DENY stats.
 */
int apply_filter_to_req_headers(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
      char term;
      char *cur_ptr, *cur_end, *cur_next;
      int cur_idx, old_idx, last_hdr;
      struct http_txn *txn = &t->txn;
      struct hdr_idx_elem *cur_hdr;
      int len, delta;

      last_hdr = 0;

      cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
      old_idx = 0;

      while (!last_hdr) {
            if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
                  return 1;
            else if (unlikely(txn->flags & TX_CLALLOW) &&
                   (exp->action == ACT_ALLOW ||
                    exp->action == ACT_DENY ||
                    exp->action == ACT_TARPIT))
                  return 0;

            cur_idx = txn->hdr_idx.v[old_idx].next;
            if (!cur_idx)
                  break;

            cur_hdr  = &txn->hdr_idx.v[cur_idx];
            cur_ptr  = cur_next;
            cur_end  = cur_ptr + cur_hdr->len;
            cur_next = cur_end + cur_hdr->cr + 1;

            /* Now we have one header between cur_ptr and cur_end,
             * and the next header starts at cur_next.
             */

            /* The annoying part is that pattern matching needs
             * that we modify the contents to null-terminate all
             * strings before testing them.
             */

            term = *cur_end;
            *cur_end = '\0';

            if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
                  switch (exp->action) {
                  case ACT_SETBE:
                        /* It is not possible to jump a second time.
                         * FIXME: should we return an HTTP/500 here so that
                         * the admin knows there's a problem ?
                         */
                        if (t->be != t->fe)
                              break;

                        /* Swithing Proxy */
                        t->be = (struct proxy *) exp->replace;

                        /* right now, the backend switch is not too much complicated
                         * because we have associated req_cap and rsp_cap to the
                         * frontend, and the beconn will be updated later.
                         */

                        t->rep->rto = t->req->wto = t->be->srvtimeout;
                        t->req->cto = t->be->contimeout;
                        last_hdr = 1;
                        break;

                  case ACT_ALLOW:
                        txn->flags |= TX_CLALLOW;
                        last_hdr = 1;
                        break;

                  case ACT_DENY:
                        txn->flags |= TX_CLDENY;
                        last_hdr = 1;
                        t->be->denied_req++;
                        break;

                  case ACT_TARPIT:
                        txn->flags |= TX_CLTARPIT;
                        last_hdr = 1;
                        t->be->denied_req++;
                        break;

                  case ACT_REPLACE:
                        len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
                        delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
                        /* FIXME: if the user adds a newline in the replacement, the
                         * index will not be recalculated for now, and the new line
                         * will not be counted as a new header.
                         */

                        cur_end += delta;
                        cur_next += delta;
                        cur_hdr->len += delta;
                        txn->req.eoh += delta;
                        break;

                  case ACT_REMOVE:
                        delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
                        cur_next += delta;

                        /* FIXME: this should be a separate function */
                        txn->req.eoh += delta;
                        txn->hdr_idx.v[old_idx].next = cur_hdr->next;
                        txn->hdr_idx.used--;
                        cur_hdr->len = 0;
                        cur_end = NULL; /* null-term has been rewritten */
                        break;

                  }
            }
            if (cur_end)
                  *cur_end = term; /* restore the string terminator */

            /* keep the link from this header to next one in case of later
             * removal of next header.
             */
            old_idx = cur_idx;
      }
      return 0;
}


/* Apply the filter to the request line.
 * Returns 0 if nothing has been done, 1 if the filter has been applied,
 * or -1 if a replacement resulted in an invalid request line.
 * Since it can manage the switch to another backend, it updates the per-proxy
 * DENY stats.
 */
int apply_filter_to_req_line(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
      char term;
      char *cur_ptr, *cur_end;
      int done;
      struct http_txn *txn = &t->txn;
      int len, delta;


      if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
            return 1;
      else if (unlikely(txn->flags & TX_CLALLOW) &&
             (exp->action == ACT_ALLOW ||
              exp->action == ACT_DENY ||
              exp->action == ACT_TARPIT))
            return 0;
      else if (exp->action == ACT_REMOVE)
            return 0;

      done = 0;

      cur_ptr = req->data + txn->req.som; /* should be equal to txn->sol */
      cur_end = cur_ptr + txn->req.sl.rq.l;

      /* Now we have the request line between cur_ptr and cur_end */

      /* The annoying part is that pattern matching needs
       * that we modify the contents to null-terminate all
       * strings before testing them.
       */

      term = *cur_end;
      *cur_end = '\0';

      if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
            switch (exp->action) {
            case ACT_SETBE:
                  /* It is not possible to jump a second time.
                   * FIXME: should we return an HTTP/500 here so that
                   * the admin knows there's a problem ?
                   */
                  if (t->be != t->fe)
                        break;

                  /* Swithing Proxy */
                  t->be = (struct proxy *) exp->replace;

                  /* right now, the backend switch is not too much complicated
                   * because we have associated req_cap and rsp_cap to the
                   * frontend, and the beconn will be updated later.
                   */

                  t->rep->rto = t->req->wto = t->be->srvtimeout;
                  t->req->cto = t->be->contimeout;
                  done = 1;
                  break;

            case ACT_ALLOW:
                  txn->flags |= TX_CLALLOW;
                  done = 1;
                  break;

            case ACT_DENY:
                  txn->flags |= TX_CLDENY;
                  t->be->denied_req++;
                  done = 1;
                  break;

            case ACT_TARPIT:
                  txn->flags |= TX_CLTARPIT;
                  t->be->denied_req++;
                  done = 1;
                  break;

            case ACT_REPLACE:
                  *cur_end = term; /* restore the string terminator */
                  len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
                  delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
                  /* FIXME: if the user adds a newline in the replacement, the
                   * index will not be recalculated for now, and the new line
                   * will not be counted as a new header.
                   */

                  txn->req.eoh += delta;
                  cur_end += delta;

                  txn->req.sol = req->data + txn->req.som; /* should be equal to txn->sol */
                  cur_end = (char *)http_parse_reqline(&txn->req, req->data,
                                               HTTP_MSG_RQMETH,
                                               cur_ptr, cur_end + 1,
                                               NULL, NULL);
                  if (unlikely(!cur_end))
                        return -1;

                  /* we have a full request and we know that we have either a CR
                   * or an LF at <ptr>.
                   */
                  txn->meth = find_http_meth(cur_ptr, txn->req.sl.rq.m_l);
                  hdr_idx_set_start(&txn->hdr_idx, txn->req.sl.rq.l, *cur_end == '\r');
                  /* there is no point trying this regex on headers */
                  return 1;
            }
      }
      *cur_end = term; /* restore the string terminator */
      return done;
}



/*
 * Apply all the req filters <exp> to all headers in buffer <req> of session <t>.
 * Returns 0 if everything is alright, or -1 in case a replacement lead to an
 * unparsable request. Since it can manage the switch to another backend, it
 * updates the per-proxy DENY stats.
 */
int apply_filters_to_request(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
      struct http_txn *txn = &t->txn;
      /* iterate through the filters in the outer loop */
      while (exp && !(txn->flags & (TX_CLDENY|TX_CLTARPIT))) {
            int ret;

            /*
             * The interleaving of transformations and verdicts
             * makes it difficult to decide to continue or stop
             * the evaluation.
             */

            if ((txn->flags & TX_CLALLOW) &&
                (exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
                 exp->action == ACT_TARPIT || exp->action == ACT_PASS)) {
                  exp = exp->next;
                  continue;
            }

            /* Apply the filter to the request line. */
            ret = apply_filter_to_req_line(t, req, exp);
            if (unlikely(ret < 0))
                  return -1;

            if (likely(ret == 0)) {
                  /* The filter did not match the request, it can be
                   * iterated through all headers.
                   */
                  apply_filter_to_req_headers(t, req, exp);
            }
            exp = exp->next;
      }
      return 0;
}



/*
 * Manager client-side cookie
 */
void manage_client_side_cookies(struct session *t, struct buffer *req)
{
      struct http_txn *txn = &t->txn;
      char *p1, *p2, *p3, *p4;
      char *del_colon, *del_cookie, *colon;
      int app_cookies;

      appsess *asession_temp = NULL;
      appsess local_asession;

      char *cur_ptr, *cur_end, *cur_next;
      int cur_idx, old_idx;

      if (t->be->cookie_name == NULL &&
          t->be->appsession_name == NULL &&
          t->be->capture_name == NULL)
            return;

      /* Iterate through the headers.
       * we start with the start line.
       */
      old_idx = 0;
      cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);

      while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
            struct hdr_idx_elem *cur_hdr;
            int val;

            cur_hdr  = &txn->hdr_idx.v[cur_idx];
            cur_ptr  = cur_next;
            cur_end  = cur_ptr + cur_hdr->len;
            cur_next = cur_end + cur_hdr->cr + 1;

            /* We have one full header between cur_ptr and cur_end, and the
             * next header starts at cur_next. We're only interested in
             * "Cookie:" headers.
             */

            val = http_header_match2(cur_ptr, cur_end, "Cookie", 6);
            if (!val) {
                  old_idx = cur_idx;
                  continue;
            }

            /* Now look for cookies. Conforming to RFC2109, we have to support
             * attributes whose name begin with a '$', and associate them with
             * the right cookie, if we want to delete this cookie.
             * So there are 3 cases for each cookie read :
             * 1) it's a special attribute, beginning with a '$' : ignore it.
             * 2) it's a server id cookie that we *MAY* want to delete : save
             *    some pointers on it (last semi-colon, beginning of cookie...)
             * 3) it's an application cookie : we *MAY* have to delete a previous
             *    "special" cookie.
             * At the end of loop, if a "special" cookie remains, we may have to
             * remove it. If no application cookie persists in the header, we
             * *MUST* delete it
             */

            colon = p1 = cur_ptr + val; /* first non-space char after 'Cookie:' */

            /* del_cookie == NULL => nothing to be deleted */
            del_colon = del_cookie = NULL;
            app_cookies = 0;
            
            while (p1 < cur_end) {
                  /* skip spaces and colons, but keep an eye on these ones */
                  while (p1 < cur_end) {
                        if (*p1 == ';' || *p1 == ',')
                              colon = p1;
                        else if (!isspace((unsigned char)*p1))
                              break;
                        p1++;
                  }

                  if (p1 == cur_end)
                        break;
                
                  /* p1 is at the beginning of the cookie name */
                  p2 = p1;
                  while (p2 < cur_end && *p2 != '=')
                        p2++;

                  if (p2 == cur_end)
                        break;

                  p3 = p2 + 1; /* skips the '=' sign */
                  if (p3 == cur_end)
                        break;
                
                  p4 = p3;
                  while (p4 < cur_end && !isspace((unsigned char)*p4) && *p4 != ';' && *p4 != ',')
                        p4++;

                  /* here, we have the cookie name between p1 and p2,
                   * and its value between p3 and p4.
                   * we can process it :
                   *
                   * Cookie: NAME=VALUE;
                   * |      ||   ||    |
                   * |      ||   ||    +--> p4
                   * |      ||   |+-------> p3
                   * |      ||   +--------> p2
                   * |      |+------------> p1
                   * |      +-------------> colon
                   * +--------------------> cur_ptr
                   */
                
                  if (*p1 == '$') {
                        /* skip this one */
                  }
                  else {
                        /* first, let's see if we want to capture it */
                        if (t->fe->capture_name != NULL &&
                            txn->cli_cookie == NULL &&
                            (p4 - p1 >= t->fe->capture_namelen) &&
                            memcmp(p1, t->fe->capture_name, t->fe->capture_namelen) == 0) {
                              int log_len = p4 - p1;

                              if ((txn->cli_cookie = pool_alloc2(pool2_capture)) == NULL) {
                                    Alert("HTTP logging : out of memory.\n");
                              } else {
                                    if (log_len > t->fe->capture_len)
                                          log_len = t->fe->capture_len;
                                    memcpy(txn->cli_cookie, p1, log_len);
                                    txn->cli_cookie[log_len] = 0;
                              }
                        }

                        if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) &&
                            (memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) {
                              /* Cool... it's the right one */
                              struct server *srv = t->be->srv;
                              char *delim;

                              /* if we're in cookie prefix mode, we'll search the delimitor so that we
                               * have the server ID betweek p3 and delim, and the original cookie between
                               * delim+1 and p4. Otherwise, delim==p4 :
                               *
                               * Cookie: NAME=SRV~VALUE;
                               * |      ||   ||  |     |
                               * |      ||   ||  |     +--> p4
                               * |      ||   ||  +--------> delim
                               * |      ||   |+-----------> p3
                               * |      ||   +------------> p2
                               * |      |+----------------> p1
                               * |      +-----------------> colon
                               * +------------------------> cur_ptr
                               */

                              if (t->be->options & PR_O_COOK_PFX) {
                                    for (delim = p3; delim < p4; delim++)
                                          if (*delim == COOKIE_DELIM)
                                                break;
                              }
                              else
                                    delim = p4;


                              /* Here, we'll look for the first running server which supports the cookie.
                               * This allows to share a same cookie between several servers, for example
                               * to dedicate backup servers to specific servers only.
                               * However, to prevent clients from sticking to cookie-less backup server
                               * when they have incidentely learned an empty cookie, we simply ignore
                               * empty cookies and mark them as invalid.
                               */
                              if (delim == p3)
                                    srv = NULL;

                              while (srv) {
                                    if (srv->cookie && (srv->cklen == delim - p3) &&
                                        !memcmp(p3, srv->cookie, delim - p3)) {
                                          if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
                                                /* we found the server and it's usable */
                                                txn->flags &= ~TX_CK_MASK;
                                                txn->flags |= TX_CK_VALID;
                                                t->flags |= SN_DIRECT | SN_ASSIGNED;
                                                t->srv = srv;
                                                break;
                                          } else {
                                                /* we found a server, but it's down */
                                                txn->flags &= ~TX_CK_MASK;
                                                txn->flags |= TX_CK_DOWN;
                                          }
                                    }
                                    srv = srv->next;
                              }

                              if (!srv && !(txn->flags & TX_CK_DOWN)) {
                                    /* no server matched this cookie */
                                    txn->flags &= ~TX_CK_MASK;
                                    txn->flags |= TX_CK_INVALID;
                              }

                              /* depending on the cookie mode, we may have to either :
                               * - delete the complete cookie if we're in insert+indirect mode, so that
                               *   the server never sees it ;
                               * - remove the server id from the cookie value, and tag the cookie as an
                               *   application cookie so that it does not get accidentely removed later,
                               *   if we're in cookie prefix mode
                               */
                              if ((t->be->options & PR_O_COOK_PFX) && (delim != p4)) {
                                    int delta; /* negative */

                                    delta = buffer_replace2(req, p3, delim + 1, NULL, 0);
                                    p4  += delta;
                                    cur_end += delta;
                                    cur_next += delta;
                                    cur_hdr->len += delta;
                                    txn->req.eoh += delta;

                                    del_cookie = del_colon = NULL;
                                    app_cookies++;    /* protect the header from deletion */
                              }
                              else if (del_cookie == NULL &&
                                     (t->be->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) {
                                    del_cookie = p1;
                                    del_colon = colon;
                              }
                        } else {
                              /* now we know that we must keep this cookie since it's
                               * not ours. But if we wanted to delete our cookie
                               * earlier, we cannot remove the complete header, but we
                               * can remove the previous block itself.
                               */
                              app_cookies++;

                              if (del_cookie != NULL) {
                                    int delta; /* negative */

                                    delta = buffer_replace2(req, del_cookie, p1, NULL, 0);
                                    p4  += delta;
                                    cur_end += delta;
                                    cur_next += delta;
                                    cur_hdr->len += delta;
                                    txn->req.eoh += delta;
                                    del_cookie = del_colon = NULL;
                              }
                        }

                        if ((t->be->appsession_name != NULL) &&
                            (memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) {
                              /* first, let's see if the cookie is our appcookie*/
                      
                              /* Cool... it's the right one */

                              asession_temp = &local_asession;
                    
                              if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
                                    Alert("Not enough memory process_cli():asession->sessid:malloc().\n");
                                    send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n");
                                    return;
                              }

                              memcpy(asession_temp->sessid, p3, t->be->appsession_len);
                              asession_temp->sessid[t->be->appsession_len] = 0;
                              asession_temp->serverid = NULL;

                              /* only do insert, if lookup fails */
                              asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid);
                              if (asession_temp == NULL) {
                                    if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
                                          /* free previously allocated memory */
                                          pool_free2(apools.sessid, local_asession.sessid);
                                          Alert("Not enough memory process_cli():asession:calloc().\n");
                                          send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
                                          return;
                                    }

                                    asession_temp->sessid = local_asession.sessid;
                                    asession_temp->serverid = local_asession.serverid;
                                    appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
                              } else {
                                    /* free previously allocated memory */
                                    pool_free2(apools.sessid, local_asession.sessid);
                              }
                              if (asession_temp->serverid == NULL) {
                                    Alert("Found Application Session without matching server.\n");
                              } else {
                                    struct server *srv = t->be->srv;
                                    while (srv) {
                                          if (strcmp(srv->id, asession_temp->serverid) == 0) {
                                                if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
                                                      /* we found the server and it's usable */
                                                      txn->flags &= ~TX_CK_MASK;
                                                      txn->flags |= TX_CK_VALID;
                                                      t->flags |= SN_DIRECT | SN_ASSIGNED;
                                                      t->srv = srv;
                                                      break;
                                                } else {
                                                      txn->flags &= ~TX_CK_MASK;
                                                      txn->flags |= TX_CK_DOWN;
                                                }
                                          }
                                          srv = srv->next;
                                    }/* end while(srv) */
                              }/* end else if server == NULL */

                              tv_add(&asession_temp->expire, &now, &t->be->appsession_timeout);
                        }/* end if ((t->proxy->appsession_name != NULL) ... */
                  }

                  /* we'll have to look for another cookie ... */
                  p1 = p4;
            } /* while (p1 < cur_end) */

            /* There's no more cookie on this line.
             * We may have marked the last one(s) for deletion.
             * We must do this now in two ways :
             *  - if there is no app cookie, we simply delete the header ;
             *  - if there are app cookies, we must delete the end of the
             *    string properly, including the colon/semi-colon before
             *    the cookie name.
             */
            if (del_cookie != NULL) {
                  int delta;
                  if (app_cookies) {
                        delta = buffer_replace2(req, del_colon, cur_end, NULL, 0);
                        cur_end = del_colon;
                        cur_hdr->len += delta;
                  } else {
                        delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);

                        /* FIXME: this should be a separate function */
                        txn->hdr_idx.v[old_idx].next = cur_hdr->next;
                        txn->hdr_idx.used--;
                        cur_hdr->len = 0;
                  }
                  cur_next += delta;
                  txn->req.eoh += delta;
            }

            /* keep the link from this header to next one */
            old_idx = cur_idx;
      } /* end of cookie processing on this header */
}


/* Iterate the same filter through all response headers contained in <rtr>.
 * Returns 1 if this filter can be stopped upon return, otherwise 0.
 */
int apply_filter_to_resp_headers(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
      char term;
      char *cur_ptr, *cur_end, *cur_next;
      int cur_idx, old_idx, last_hdr;
      struct http_txn *txn = &t->txn;
      struct hdr_idx_elem *cur_hdr;
      int len, delta;

      last_hdr = 0;

      cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
      old_idx = 0;

      while (!last_hdr) {
            if (unlikely(txn->flags & TX_SVDENY))
                  return 1;
            else if (unlikely(txn->flags & TX_SVALLOW) &&
                   (exp->action == ACT_ALLOW ||
                    exp->action == ACT_DENY))
                  return 0;

            cur_idx = txn->hdr_idx.v[old_idx].next;
            if (!cur_idx)
                  break;

            cur_hdr  = &txn->hdr_idx.v[cur_idx];
            cur_ptr  = cur_next;
            cur_end  = cur_ptr + cur_hdr->len;
            cur_next = cur_end + cur_hdr->cr + 1;

            /* Now we have one header between cur_ptr and cur_end,
             * and the next header starts at cur_next.
             */

            /* The annoying part is that pattern matching needs
             * that we modify the contents to null-terminate all
             * strings before testing them.
             */

            term = *cur_end;
            *cur_end = '\0';

            if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
                  switch (exp->action) {
                  case ACT_ALLOW:
                        txn->flags |= TX_SVALLOW;
                        last_hdr = 1;
                        break;

                  case ACT_DENY:
                        txn->flags |= TX_SVDENY;
                        last_hdr = 1;
                        break;

                  case ACT_REPLACE:
                        len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
                        delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
                        /* FIXME: if the user adds a newline in the replacement, the
                         * index will not be recalculated for now, and the new line
                         * will not be counted as a new header.
                         */

                        cur_end += delta;
                        cur_next += delta;
                        cur_hdr->len += delta;
                        txn->rsp.eoh += delta;
                        break;

                  case ACT_REMOVE:
                        delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
                        cur_next += delta;

                        /* FIXME: this should be a separate function */
                        txn->rsp.eoh += delta;
                        txn->hdr_idx.v[old_idx].next = cur_hdr->next;
                        txn->hdr_idx.used--;
                        cur_hdr->len = 0;
                        cur_end = NULL; /* null-term has been rewritten */
                        break;

                  }
            }
            if (cur_end)
                  *cur_end = term; /* restore the string terminator */

            /* keep the link from this header to next one in case of later
             * removal of next header.
             */
            old_idx = cur_idx;
      }
      return 0;
}


/* Apply the filter to the status line in the response buffer <rtr>.
 * Returns 0 if nothing has been done, 1 if the filter has been applied,
 * or -1 if a replacement resulted in an invalid status line.
 */
int apply_filter_to_sts_line(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
      char term;
      char *cur_ptr, *cur_end;
      int done;
      struct http_txn *txn = &t->txn;
      int len, delta;


      if (unlikely(txn->flags & TX_SVDENY))
            return 1;
      else if (unlikely(txn->flags & TX_SVALLOW) &&
             (exp->action == ACT_ALLOW ||
              exp->action == ACT_DENY))
            return 0;
      else if (exp->action == ACT_REMOVE)
            return 0;

      done = 0;

      cur_ptr = rtr->data + txn->rsp.som; /* should be equal to txn->sol */
      cur_end = cur_ptr + txn->rsp.sl.rq.l;

      /* Now we have the status line between cur_ptr and cur_end */

      /* The annoying part is that pattern matching needs
       * that we modify the contents to null-terminate all
       * strings before testing them.
       */

      term = *cur_end;
      *cur_end = '\0';

      if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
            switch (exp->action) {
            case ACT_ALLOW:
                  txn->flags |= TX_SVALLOW;
                  done = 1;
                  break;

            case ACT_DENY:
                  txn->flags |= TX_SVDENY;
                  done = 1;
                  break;

            case ACT_REPLACE:
                  *cur_end = term; /* restore the string terminator */
                  len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
                  delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
                  /* FIXME: if the user adds a newline in the replacement, the
                   * index will not be recalculated for now, and the new line
                   * will not be counted as a new header.
                   */

                  txn->rsp.eoh += delta;
                  cur_end += delta;

                  txn->rsp.sol = rtr->data + txn->rsp.som; /* should be equal to txn->sol */
                  cur_end = (char *)http_parse_stsline(&txn->rsp, rtr->data,
                                               HTTP_MSG_RPVER,
                                               cur_ptr, cur_end + 1,
                                               NULL, NULL);
                  if (unlikely(!cur_end))
                        return -1;

                  /* we have a full respnse and we know that we have either a CR
                   * or an LF at <ptr>.
                   */
                  txn->status = strl2ui(rtr->data + txn->rsp.sl.st.c, txn->rsp.sl.st.c_l);
                  hdr_idx_set_start(&txn->hdr_idx, txn->rsp.sl.rq.l, *cur_end == '\r');
                  /* there is no point trying this regex on headers */
                  return 1;
            }
      }
      *cur_end = term; /* restore the string terminator */
      return done;
}



/*
 * Apply all the resp filters <exp> to all headers in buffer <rtr> of session <t>.
 * Returns 0 if everything is alright, or -1 in case a replacement lead to an
 * unparsable response.
 */
int apply_filters_to_response(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
      struct http_txn *txn = &t->txn;
      /* iterate through the filters in the outer loop */
      while (exp && !(txn->flags & TX_SVDENY)) {
            int ret;

            /*
             * The interleaving of transformations and verdicts
             * makes it difficult to decide to continue or stop
             * the evaluation.
             */

            if ((txn->flags & TX_SVALLOW) &&
                (exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
                 exp->action == ACT_PASS)) {
                  exp = exp->next;
                  continue;
            }

            /* Apply the filter to the status line. */
            ret = apply_filter_to_sts_line(t, rtr, exp);
            if (unlikely(ret < 0))
                  return -1;

            if (likely(ret == 0)) {
                  /* The filter did not match the response, it can be
                   * iterated through all headers.
                   */
                  apply_filter_to_resp_headers(t, rtr, exp);
            }
            exp = exp->next;
      }
      return 0;
}



/*
 * Manager server-side cookies
 */
void manage_server_side_cookies(struct session *t, struct buffer *rtr)
{
      struct http_txn *txn = &t->txn;
      char *p1, *p2, *p3, *p4;

      appsess *asession_temp = NULL;
      appsess local_asession;

      char *cur_ptr, *cur_end, *cur_next;
      int cur_idx, old_idx, delta;

      if (t->be->cookie_name == NULL &&
          t->be->appsession_name == NULL &&
          t->be->capture_name == NULL &&
          !(t->be->options & PR_O_CHK_CACHE))
            return;

      /* Iterate through the headers.
       * we start with the start line.
       */
      old_idx = 0;
      cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);

      while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
            struct hdr_idx_elem *cur_hdr;
            int val;

            cur_hdr  = &txn->hdr_idx.v[cur_idx];
            cur_ptr  = cur_next;
            cur_end  = cur_ptr + cur_hdr->len;
            cur_next = cur_end + cur_hdr->cr + 1;

            /* We have one full header between cur_ptr and cur_end, and the
             * next header starts at cur_next. We're only interested in
             * "Cookie:" headers.
             */

            val = http_header_match2(cur_ptr, cur_end, "Set-Cookie", 10);
            if (!val) {
                  old_idx = cur_idx;
                  continue;
            }

            /* OK, right now we know we have a set-cookie at cur_ptr */
            txn->flags |= TX_SCK_ANY;


            /* maybe we only wanted to see if there was a set-cookie */
            if (t->be->cookie_name == NULL &&
                t->be->appsession_name == NULL &&
                t->be->capture_name == NULL)
                  return;

            p1 = cur_ptr + val; /* first non-space char after 'Set-Cookie:' */
            
            while (p1 < cur_end) { /* in fact, we'll break after the first cookie */
                  if (p1 == cur_end || *p1 == ';') /* end of cookie */
                        break;

                  /* p1 is at the beginning of the cookie name */
                  p2 = p1;

                  while (p2 < cur_end && *p2 != '=' && *p2 != ';')
                        p2++;

                  if (p2 == cur_end || *p2 == ';') /* next cookie */
                        break;

                  p3 = p2 + 1; /* skip the '=' sign */
                  if (p3 == cur_end)
                        break;

                  p4 = p3;
                  while (p4 < cur_end && !isspace((unsigned char)*p4) && *p4 != ';')
                        p4++;

                  /* here, we have the cookie name between p1 and p2,
                   * and its value between p3 and p4.
                   * we can process it.
                   */

                  /* first, let's see if we want to capture it */
                  if (t->be->capture_name != NULL &&
                      txn->srv_cookie == NULL &&
                      (p4 - p1 >= t->be->capture_namelen) &&
                      memcmp(p1, t->be->capture_name, t->be->capture_namelen) == 0) {
                        int log_len = p4 - p1;

                        if ((txn->srv_cookie = pool_alloc2(pool2_capture)) == NULL) {
                              Alert("HTTP logging : out of memory.\n");
                        }

                        if (log_len > t->be->capture_len)
                              log_len = t->be->capture_len;
                        memcpy(txn->srv_cookie, p1, log_len);
                        txn->srv_cookie[log_len] = 0;
                  }

                  /* now check if we need to process it for persistence */
                  if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) &&
                      (memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) {
                        /* Cool... it's the right one */
                        txn->flags |= TX_SCK_SEEN;
                  
                        /* If the cookie is in insert mode on a known server, we'll delete
                         * this occurrence because we'll insert another one later.
                         * We'll delete it too if the "indirect" option is set and we're in
                         * a direct access. */
                        if (((t->srv) && (t->be->options & PR_O_COOK_INS)) ||
                            ((t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_IND))) {
                              /* this header must be deleted */
                              delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
                              txn->hdr_idx.v[old_idx].next = cur_hdr->next;
                              txn->hdr_idx.used--;
                              cur_hdr->len = 0;
                              cur_next += delta;
                              txn->rsp.eoh += delta;

                              txn->flags |= TX_SCK_DELETED;
                        }
                        else if ((t->srv) && (t->srv->cookie) &&
                               (t->be->options & PR_O_COOK_RW)) {
                              /* replace bytes p3->p4 with the cookie name associated
                               * with this server since we know it.
                               */
                              delta = buffer_replace2(rtr, p3, p4, t->srv->cookie, t->srv->cklen);
                              cur_hdr->len += delta;
                              cur_next += delta;
                              txn->rsp.eoh += delta;

                              txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
                        }
                        else if ((t->srv) && (t->srv->cookie) &&
                               (t->be->options & PR_O_COOK_PFX)) {
                              /* insert the cookie name associated with this server
                               * before existing cookie, and insert a delimitor between them..
                               */
                              delta = buffer_replace2(rtr, p3, p3, t->srv->cookie, t->srv->cklen + 1);
                              cur_hdr->len += delta;
                              cur_next += delta;
                              txn->rsp.eoh += delta;

                              p3[t->srv->cklen] = COOKIE_DELIM;
                              txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
                        }
                  }
                  /* next, let's see if the cookie is our appcookie */
                  else if ((t->be->appsession_name != NULL) &&
                           (memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) {

                        /* Cool... it's the right one */

                        size_t server_id_len = strlen(t->srv->id) + 1;
                        asession_temp = &local_asession;
                  
                        if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
                              Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
                              send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
                              return;
                        }
                        memcpy(asession_temp->sessid, p3, t->be->appsession_len);
                        asession_temp->sessid[t->be->appsession_len] = 0;
                        asession_temp->serverid = NULL;

                        /* only do insert, if lookup fails */
                        if (appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid) == NULL) {
                              if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
                                    Alert("Not enough Memory process_srv():asession:calloc().\n");
                                    send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession:calloc().\n");
                                    return;
                              }
                              asession_temp->sessid = local_asession.sessid;
                              asession_temp->serverid = local_asession.serverid;
                              appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
                        } else {
                              /* free wasted memory */
                              pool_free2(apools.sessid, local_asession.sessid);
                        }

                        if (asession_temp->serverid == NULL) {
                              if ((asession_temp->serverid = pool_alloc2(apools.serverid)) == NULL) {
                                    Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
                                    send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
                                    return;
                              }
                              asession_temp->serverid[0] = '\0';
                        }
                  
                        if (asession_temp->serverid[0] == '\0')
                              memcpy(asession_temp->serverid, t->srv->id, server_id_len);
                  
                        tv_add(&asession_temp->expire, &now, &t->be->appsession_timeout);

#if defined(DEBUG_HASH)
                        appsession_hash_dump(&(t->be->htbl_proxy));
#endif
                  }/* end if ((t->proxy->appsession_name != NULL) ... */
                  break; /* we don't want to loop again since there cannot be another cookie on the same line */
            } /* we're now at the end of the cookie value */

            /* keep the link from this header to next one */
            old_idx = cur_idx;
      } /* end of cookie processing on this header */
}



/*
 * Check if response is cacheable or not. Updates t->flags.
 */
void check_response_for_cacheability(struct session *t, struct buffer *rtr)
{
      struct http_txn *txn = &t->txn;
      char *p1, *p2;

      char *cur_ptr, *cur_end, *cur_next;
      int cur_idx;

      if (!txn->flags & TX_CACHEABLE)
            return;

      /* Iterate through the headers.
       * we start with the start line.
       */
      cur_idx = 0;
      cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);

      while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
            struct hdr_idx_elem *cur_hdr;
            int val;

            cur_hdr  = &txn->hdr_idx.v[cur_idx];
            cur_ptr  = cur_next;
            cur_end  = cur_ptr + cur_hdr->len;
            cur_next = cur_end + cur_hdr->cr + 1;

            /* We have one full header between cur_ptr and cur_end, and the
             * next header starts at cur_next. We're only interested in
             * "Cookie:" headers.
             */

            val = http_header_match2(cur_ptr, cur_end, "Pragma", 6);
            if (val) {
                  if ((cur_end - (cur_ptr + val) >= 8) &&
                      strncasecmp(cur_ptr + val, "no-cache", 8) == 0) {
                        txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
                        return;
                  }
            }

            val = http_header_match2(cur_ptr, cur_end, "Cache-control", 13);
            if (!val)
                  continue;

            /* OK, right now we know we have a cache-control header at cur_ptr */

            p1 = cur_ptr + val; /* first non-space char after 'cache-control:' */

            if (p1 >= cur_end)      /* no more info */
                  continue;

            /* p1 is at the beginning of the value */
            p2 = p1;

            while (p2 < cur_end && *p2 != '=' && *p2 != ',' && !isspace((unsigned char)*p2))
                  p2++;

            /* we have a complete value between p1 and p2 */
            if (p2 < cur_end && *p2 == '=') {
                  /* we have something of the form no-cache="set-cookie" */
                  if ((cur_end - p1 >= 21) &&
                      strncasecmp(p1, "no-cache=\"set-cookie", 20) == 0
                      && (p1[20] == '"' || p1[20] == ','))
                        txn->flags &= ~TX_CACHE_COOK;
                  continue;
            }

            /* OK, so we know that either p2 points to the end of string or to a comma */
            if (((p2 - p1 ==  7) && strncasecmp(p1, "private", 7) == 0) ||
                ((p2 - p1 ==  8) && strncasecmp(p1, "no-store", 8) == 0) ||
                ((p2 - p1 ==  9) && strncasecmp(p1, "max-age=0", 9) == 0) ||
                ((p2 - p1 == 10) && strncasecmp(p1, "s-maxage=0", 10) == 0)) {
                  txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
                  return;
            }

            if ((p2 - p1 ==  6) && strncasecmp(p1, "public", 6) == 0) {
                  txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
                  continue;
            }
      }
}


/*
 * Try to retrieve a known appsession in the URI, then the associated server.
 * If the server is found, it's assigned to the session.
 */
void get_srv_from_appsession(struct session *t, const char *begin, int len)
{
      struct http_txn *txn = &t->txn;
      appsess *asession_temp = NULL;
      appsess local_asession;
      char *request_line;

      if (t->be->appsession_name == NULL ||
          (t->txn.meth != HTTP_METH_GET && t->txn.meth != HTTP_METH_POST) ||
          (request_line = memchr(begin, ';', len)) == NULL ||
          ((1 + t->be->appsession_name_len + 1 + t->be->appsession_len) > (begin + len - request_line)))
            return;

      /* skip ';' */
      request_line++;

      /* look if we have a jsessionid */
      if (strncasecmp(request_line, t->be->appsession_name, t->be->appsession_name_len) != 0)
            return;

      /* skip jsessionid= */
      request_line += t->be->appsession_name_len + 1;
      
      /* First try if we already have an appsession */
      asession_temp = &local_asession;
      
      if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
            Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n");
            send_log(t->be, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n");
            return;
      }
      
      /* Copy the sessionid */
      memcpy(asession_temp->sessid, request_line, t->be->appsession_len);
      asession_temp->sessid[t->be->appsession_len] = 0;
      asession_temp->serverid = NULL;
      
      /* only do insert, if lookup fails */
      if (appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid) == NULL) {
            if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
                  /* free previously allocated memory */
                  pool_free2(apools.sessid, local_asession.sessid);
                  Alert("Not enough memory process_cli():asession:calloc().\n");
                  send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
                  return;
            }
            asession_temp->sessid = local_asession.sessid;
            asession_temp->serverid = local_asession.serverid;
            appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
      }
      else {
            /* free previously allocated memory */
            pool_free2(apools.sessid, local_asession.sessid);
      }

      tv_add(&asession_temp->expire, &now, &t->be->appsession_timeout);
      asession_temp->request_count++;

#if defined(DEBUG_HASH)
      appsession_hash_dump(&(t->be->htbl_proxy));
#endif
      if (asession_temp->serverid == NULL) {
            Alert("Found Application Session without matching server.\n");
      } else {
            struct server *srv = t->be->srv;
            while (srv) {
                  if (strcmp(srv->id, asession_temp->serverid) == 0) {
                        if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
                              /* we found the server and it's usable */
                              txn->flags &= ~TX_CK_MASK;
                              txn->flags |= TX_CK_VALID;
                              t->flags |= SN_DIRECT | SN_ASSIGNED;
                              t->srv = srv;
                              break;
                        } else {
                              txn->flags &= ~TX_CK_MASK;
                              txn->flags |= TX_CK_DOWN;
                        }
                  }
                  srv = srv->next;
            }
      }
}


/*
 * In a GET or HEAD request, check if the requested URI matches the stats uri
 * for the current backend, and if an authorization has been passed and is valid.
 *
 * It is assumed that the request is either a HEAD or GET and that the
 * t->be->uri_auth field is valid. An HTTP/401 response may be sent, or
 * produce_content() can be called to start sending data.
 *
 * Returns 1 if the session's state changes, otherwise 0.
 */
int stats_check_uri_auth(struct session *t, struct proxy *backend)
{
      struct http_txn *txn = &t->txn;
      struct uri_auth *uri_auth = backend->uri_auth;
      struct user_auth *user;
      int authenticated, cur_idx;
      char *h;

      /* check URI size */
      if (uri_auth->uri_len > txn->req.sl.rq.u_l)
            return 0;

      h = t->req->data + txn->req.sl.rq.u;

      /* the URI is in h */
      if (memcmp(h, uri_auth->uri_prefix, uri_auth->uri_len) != 0)
            return 0;

      /* we are in front of a interceptable URI. Let's check
       * if there's an authentication and if it's valid.
       */
      user = uri_auth->users;
      if (!user) {
            /* no user auth required, it's OK */
            authenticated = 1;
      } else {
            authenticated = 0;

            /* a user list is defined, we have to check.
             * skip 21 chars for "Authorization: Basic ".
             */

            /* FIXME: this should move to an earlier place */
            cur_idx = 0;
            h = t->req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
            while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
                  int len = txn->hdr_idx.v[cur_idx].len;
                  if (len > 14 &&
                      !strncasecmp("Authorization:", h, 14)) {
                        txn->auth_hdr.str = h;
                        txn->auth_hdr.len = len;
                        break;
                  }
                  h += len + txn->hdr_idx.v[cur_idx].cr + 1;
            }

            if (txn->auth_hdr.len < 21 ||
                memcmp(txn->auth_hdr.str + 14, " Basic ", 7))
                  user = NULL;

            while (user) {
                  if ((txn->auth_hdr.len == user->user_len + 14 + 7)
                      && !memcmp(txn->auth_hdr.str + 14 + 7,
                               user->user_pwd, user->user_len)) {
                        authenticated = 1;
                        break;
                  }
                  user = user->next;
            }
      }

      if (!authenticated) {
            struct chunk msg;

            /* no need to go further */
            msg.str = trash;
            msg.len = sprintf(trash, HTTP_401_fmt, uri_auth->auth_realm);
            txn->status = 401;
            client_retnclose(t, &msg);
            if (!(t->flags & SN_ERR_MASK))
                  t->flags |= SN_ERR_PRXCOND;
            if (!(t->flags & SN_FINST_MASK))
                  t->flags |= SN_FINST_R;
            return 1;
      }

      /* The request is valid, the user is authenticate. Let's start sending
       * data.
       */
      t->cli_state = CL_STSHUTR;
      t->req->rlim = t->req->data + BUFSIZE; /* no more rewrite needed */
      t->logs.t_request = tv_ms_elapsed(&t->logs.tv_accept, &now);
      t->data_source = DATA_SRC_STATS;
      t->data_state  = DATA_ST_INIT;
      produce_content(t);
      return 1;
}


/*
 * Print a debug line with a header
 */
void debug_hdr(const char *dir, struct session *t, const char *start, const char *end)
{
      int len, max;
      len = sprintf(trash, "%08x:%s.%s[%04x:%04x]: ", t->uniq_id, t->be->id,
                  dir, (unsigned  short)t->cli_fd, (unsigned short)t->srv_fd);
      max = end - start;
      UBOUND(max, sizeof(trash) - len - 1);
      len += strlcpy2(trash + len, start, max + 1);
      trash[len++] = '\n';
      write(1, trash, len);
}


/************************************************************************/
/*        The code below is dedicated to ACL parsing and matching       */
/************************************************************************/




/* 1. Check on METHOD
 * We use the pre-parsed method if it is known, and store its number as an
 * integer. If it is unknown, we use the pointer and the length.
 */
static int acl_parse_meth(const char **text, struct acl_pattern *pattern, int *opaque)
{
      int len, meth;

      len  = strlen(*text);
      meth = find_http_meth(*text, len);

      pattern->val.i = meth;
      if (meth == HTTP_METH_OTHER) {
            pattern->ptr.str = strdup(*text);
            if (!pattern->ptr.str)
                  return 0;
            pattern->len = len;
      }
      return 1;
}

static int
acl_fetch_meth(struct proxy *px, struct session *l4, void *l7, int dir,
               struct acl_expr *expr, struct acl_test *test)
{
      int meth;
      struct http_txn *txn = l7;

      if (txn->req.msg_state != HTTP_MSG_BODY)
            return 0;

      meth = txn->meth;
      test->i = meth;
      if (meth == HTTP_METH_OTHER) {
            if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
                  /* ensure the indexes are not affected */
                  return 0;
            test->len = txn->req.sl.rq.m_l;
            test->ptr = txn->req.sol;
      }
      test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
      return 1;
}

static int acl_match_meth(struct acl_test *test, struct acl_pattern *pattern)
{
      int icase;

      if (test->i != pattern->val.i)
            return 0;

      if (test->i != HTTP_METH_OTHER)
            return 1;

      /* Other method, we must compare the strings */
      if (pattern->len != test->len)
            return 0;

      icase = pattern->flags & ACL_PAT_F_IGNORE_CASE;
      if ((icase && strncasecmp(pattern->ptr.str, test->ptr, test->len) != 0) ||
          (!icase && strncmp(pattern->ptr.str, test->ptr, test->len) != 0))
            return 0;
      return 1;
}

/* 2. Check on Request/Status Version
 * We simply compare strings here.
 */
static int acl_parse_ver(const char **text, struct acl_pattern *pattern, int *opaque)
{
      pattern->ptr.str = strdup(*text);
      if (!pattern->ptr.str)
            return 0;
      pattern->len = strlen(*text);
      return 1;
}

static int
acl_fetch_rqver(struct proxy *px, struct session *l4, void *l7, int dir,
                struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;
      char *ptr;
      int len;

      if (txn->req.msg_state != HTTP_MSG_BODY)
            return 0;

      len = txn->req.sl.rq.v_l;
      ptr = txn->req.sol + txn->req.sl.rq.v - txn->req.som;

      while ((len-- > 0) && (*ptr++ != '/'));
      if (len <= 0)
            return 0;

      test->ptr = ptr;
      test->len = len;

      test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
      return 1;
}

static int
acl_fetch_stver(struct proxy *px, struct session *l4, void *l7, int dir,
                struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;
      char *ptr;
      int len;

      if (txn->rsp.msg_state != HTTP_MSG_BODY)
            return 0;

      len = txn->rsp.sl.st.v_l;
      ptr = txn->rsp.sol;

      while ((len-- > 0) && (*ptr++ != '/'));
      if (len <= 0)
            return 0;

      test->ptr = ptr;
      test->len = len;

      test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
      return 1;
}

/* 3. Check on Status Code. We manipulate integers here. */
static int
acl_fetch_stcode(struct proxy *px, struct session *l4, void *l7, int dir,
                 struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;
      char *ptr;
      int len;

      if (txn->rsp.msg_state != HTTP_MSG_BODY)
            return 0;

      len = txn->rsp.sl.st.c_l;
      ptr = txn->rsp.sol + txn->rsp.sl.st.c - txn->rsp.som;

      test->i = __strl2ui(ptr, len);
      test->flags = ACL_TEST_F_VOL_1ST;
      return 1;
}

/* 4. Check on URL/URI. A pointer to the URI is stored. */
static int
acl_fetch_url(struct proxy *px, struct session *l4, void *l7, int dir,
              struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;

      if (txn->req.msg_state != HTTP_MSG_BODY)
            return 0;
      if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
            /* ensure the indexes are not affected */
            return 0;

      test->len = txn->req.sl.rq.u_l;
      test->ptr = txn->req.sol + txn->req.sl.rq.u;

      /* we do not need to set READ_ONLY because the data is in a buffer */
      test->flags = ACL_TEST_F_VOL_1ST;
      return 1;
}

/* 5. Check on HTTP header. A pointer to the beginning of the value is returned.
 * This generic function is used by both acl_fetch_chdr() and acl_fetch_shdr().
 */
static int
acl_fetch_hdr(struct proxy *px, struct session *l4, void *l7, char *sol,
              struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;
      struct hdr_idx *idx = &txn->hdr_idx;
      struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a;

      if (!(test->flags & ACL_TEST_F_FETCH_MORE))
            /* search for header from the beginning */
            ctx->idx = 0;

      if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) {
            test->flags |= ACL_TEST_F_FETCH_MORE;
            test->flags |= ACL_TEST_F_VOL_HDR;
            test->len = ctx->vlen;
            test->ptr = (char *)ctx->line + ctx->val;
            return 1;
      }

      test->flags &= ~ACL_TEST_F_FETCH_MORE;
      test->flags |= ACL_TEST_F_VOL_HDR;
      return 0;
}

static int
acl_fetch_chdr(struct proxy *px, struct session *l4, void *l7, int dir,
             struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;

      if (txn->req.msg_state != HTTP_MSG_BODY)
            return 0;
      if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
            /* ensure the indexes are not affected */
            return 0;

      return acl_fetch_hdr(px, l4, txn, txn->req.sol, expr, test);
}

static int
acl_fetch_shdr(struct proxy *px, struct session *l4, void *l7, int dir,
             struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;

      if (txn->rsp.msg_state != HTTP_MSG_BODY)
            return 0;

      return acl_fetch_hdr(px, l4, txn, txn->rsp.sol, expr, test);
}

/* 6. Check on HTTP header count. The number of occurrences is returned.
 * This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*.
 */
static int
acl_fetch_hdr_cnt(struct proxy *px, struct session *l4, void *l7, char *sol,
                  struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;
      struct hdr_idx *idx = &txn->hdr_idx;
      struct hdr_ctx ctx;
      int cnt;

      ctx.idx = 0;
      cnt = 0;
      while (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, &ctx))
            cnt++;

      test->i = cnt;
      test->flags = ACL_TEST_F_VOL_HDR;
      return 1;
}

static int
acl_fetch_chdr_cnt(struct proxy *px, struct session *l4, void *l7, int dir,
               struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;

      if (txn->req.msg_state != HTTP_MSG_BODY)
            return 0;
      if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
            /* ensure the indexes are not affected */
            return 0;

      return acl_fetch_hdr_cnt(px, l4, txn, txn->req.sol, expr, test);
}

static int
acl_fetch_shdr_cnt(struct proxy *px, struct session *l4, void *l7, int dir,
               struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;

      if (txn->rsp.msg_state != HTTP_MSG_BODY)
            return 0;

      return acl_fetch_hdr_cnt(px, l4, txn, txn->rsp.sol, expr, test);
}

/* 7. Check on HTTP header's integer value. The integer value is returned.
 * FIXME: the type is 'int', it may not be appropriate for everything.
 * This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*.
 */
static int
acl_fetch_hdr_val(struct proxy *px, struct session *l4, void *l7, char *sol,
                  struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;
      struct hdr_idx *idx = &txn->hdr_idx;
      struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a;

      if (!(test->flags & ACL_TEST_F_FETCH_MORE))
            /* search for header from the beginning */
            ctx->idx = 0;

      if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) {
            test->flags |= ACL_TEST_F_FETCH_MORE;
            test->flags |= ACL_TEST_F_VOL_HDR;
            test->i = strl2ic((char *)ctx->line + ctx->val, ctx->vlen);
            return 1;
      }

      test->flags &= ~ACL_TEST_F_FETCH_MORE;
      test->flags |= ACL_TEST_F_VOL_HDR;
      return 0;
}

static int
acl_fetch_chdr_val(struct proxy *px, struct session *l4, void *l7, int dir,
               struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;

      if (txn->req.msg_state != HTTP_MSG_BODY)
            return 0;
      if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
            /* ensure the indexes are not affected */
            return 0;

      return acl_fetch_hdr_val(px, l4, txn, txn->req.sol, expr, test);
}

static int
acl_fetch_shdr_val(struct proxy *px, struct session *l4, void *l7, int dir,
               struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;

      if (txn->rsp.msg_state != HTTP_MSG_BODY)
            return 0;

      return acl_fetch_hdr_val(px, l4, txn, txn->rsp.sol, expr, test);
}

/* 8. Check on URI PATH. A pointer to the PATH is stored. The path starts at
 * the first '/' after the possible hostname, and ends before the possible '?'.
 */
static int
acl_fetch_path(struct proxy *px, struct session *l4, void *l7, int dir,
               struct acl_expr *expr, struct acl_test *test)
{
      struct http_txn *txn = l7;
      char *ptr, *end;

      if (txn->req.msg_state != HTTP_MSG_BODY)
            return 0;
      if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
            /* ensure the indexes are not affected */
            return 0;

      ptr = txn->req.sol + txn->req.sl.rq.u;
      end = ptr + txn->req.sl.rq.u_l;

      if (ptr >= end)
            return 0;

      /* RFC2616, par. 5.1.2 :
       * Request-URI = "*" | absuri | abspath | authority
       */

      if (*ptr == '*')
            return 0;

      if (isalpha((unsigned char)*ptr)) {
            /* this is a scheme as described by RFC3986, par. 3.1 */
            ptr++;
            while (ptr < end &&
                   (isalnum((unsigned char)*ptr) || *ptr == '+' || *ptr == '-' || *ptr == '.'))
                  ptr++;
            /* skip '://' */
            if (ptr == end || *ptr++ != ':')
                  return 0;
            if (ptr == end || *ptr++ != '/')
                  return 0;
            if (ptr == end || *ptr++ != '/')
                  return 0;
      }
      /* skip [user[:passwd]@]host[:[port]] */

      while (ptr < end && *ptr != '/')
            ptr++;

      if (ptr == end)
            return 0;

      /* OK, we got the '/' ! */
      test->ptr = ptr;

      while (ptr < end && *ptr != '?')
            ptr++;

      test->len = ptr - test->ptr;

      /* we do not need to set READ_ONLY because the data is in a buffer */
      test->flags = ACL_TEST_F_VOL_1ST;
      return 1;
}



/************************************************************************/
/*             All supported keywords must be declared here.            */
/************************************************************************/

/* Note: must not be declared <const> as its list will be overwritten */
static struct acl_kw_list acl_kws = {{ },{
      { "method",     acl_parse_meth,  acl_fetch_meth,   acl_match_meth },
      { "req_ver",    acl_parse_ver,   acl_fetch_rqver,  acl_match_str  },
      { "resp_ver",   acl_parse_ver,   acl_fetch_stver,  acl_match_str  },
      { "status",     acl_parse_int,   acl_fetch_stcode, acl_match_int  },

      { "url",        acl_parse_str,   acl_fetch_url,    acl_match_str  },
      { "url_beg",    acl_parse_str,   acl_fetch_url,    acl_match_beg  },
      { "url_end",    acl_parse_str,   acl_fetch_url,    acl_match_end  },
      { "url_sub",    acl_parse_str,   acl_fetch_url,    acl_match_sub  },
      { "url_dir",    acl_parse_str,   acl_fetch_url,    acl_match_dir  },
      { "url_dom",    acl_parse_str,   acl_fetch_url,    acl_match_dom  },
      { "url_reg",    acl_parse_reg,   acl_fetch_url,    acl_match_reg  },

      { "hdr",        acl_parse_str,   acl_fetch_chdr,    acl_match_str },
      { "hdr_reg",    acl_parse_reg,   acl_fetch_chdr,    acl_match_reg },
      { "hdr_beg",    acl_parse_str,   acl_fetch_chdr,    acl_match_beg },
      { "hdr_end",    acl_parse_str,   acl_fetch_chdr,    acl_match_end },
      { "hdr_sub",    acl_parse_str,   acl_fetch_chdr,    acl_match_sub },
      { "hdr_dir",    acl_parse_str,   acl_fetch_chdr,    acl_match_dir },
      { "hdr_dom",    acl_parse_str,   acl_fetch_chdr,    acl_match_dom },
      { "hdr_cnt",    acl_parse_int,   acl_fetch_chdr_cnt,acl_match_int },
      { "hdr_val",    acl_parse_int,   acl_fetch_chdr_val,acl_match_int },

      { "shdr",       acl_parse_str,   acl_fetch_shdr,    acl_match_str },
      { "shdr_reg",   acl_parse_reg,   acl_fetch_shdr,    acl_match_reg },
      { "shdr_beg",   acl_parse_str,   acl_fetch_shdr,    acl_match_beg },
      { "shdr_end",   acl_parse_str,   acl_fetch_shdr,    acl_match_end },
      { "shdr_sub",   acl_parse_str,   acl_fetch_shdr,    acl_match_sub },
      { "shdr_dir",   acl_parse_str,   acl_fetch_shdr,    acl_match_dir },
      { "shdr_dom",   acl_parse_str,   acl_fetch_shdr,    acl_match_dom },
      { "shdr_cnt",   acl_parse_int,   acl_fetch_shdr_cnt,acl_match_int },
      { "shdr_val",   acl_parse_int,   acl_fetch_shdr_val,acl_match_int },

      { "path",       acl_parse_str,   acl_fetch_path,   acl_match_str  },
      { "path_reg",   acl_parse_reg,   acl_fetch_path,   acl_match_reg  },
      { "path_beg",   acl_parse_str,   acl_fetch_path,   acl_match_beg  },
      { "path_end",   acl_parse_str,   acl_fetch_path,   acl_match_end  },
      { "path_sub",   acl_parse_str,   acl_fetch_path,   acl_match_sub  },
      { "path_dir",   acl_parse_str,   acl_fetch_path,   acl_match_dir  },
      { "path_dom",   acl_parse_str,   acl_fetch_path,   acl_match_dom  },

      { NULL, NULL, NULL, NULL },

#if 0
      { "line",       acl_parse_str,   acl_fetch_line,   acl_match_str   },
      { "line_reg",   acl_parse_reg,   acl_fetch_line,   acl_match_reg   },
      { "line_beg",   acl_parse_str,   acl_fetch_line,   acl_match_beg   },
      { "line_end",   acl_parse_str,   acl_fetch_line,   acl_match_end   },
      { "line_sub",   acl_parse_str,   acl_fetch_line,   acl_match_sub   },
      { "line_dir",   acl_parse_str,   acl_fetch_line,   acl_match_dir   },
      { "line_dom",   acl_parse_str,   acl_fetch_line,   acl_match_dom   },

      { "cook",       acl_parse_str,   acl_fetch_cook,   acl_match_str   },
      { "cook_reg",   acl_parse_reg,   acl_fetch_cook,   acl_match_reg   },
      { "cook_beg",   acl_parse_str,   acl_fetch_cook,   acl_match_beg   },
      { "cook_end",   acl_parse_str,   acl_fetch_cook,   acl_match_end   },
      { "cook_sub",   acl_parse_str,   acl_fetch_cook,   acl_match_sub   },
      { "cook_dir",   acl_parse_str,   acl_fetch_cook,   acl_match_dir   },
      { "cook_dom",   acl_parse_str,   acl_fetch_cook,   acl_match_dom   },
      { "cook_pst",   acl_parse_none,  acl_fetch_cook,   acl_match_pst   },

      { "auth_user",  acl_parse_str,   acl_fetch_user,   acl_match_str   },
      { "auth_regex", acl_parse_reg,   acl_fetch_user,   acl_match_reg   },
      { "auth_clear", acl_parse_str,   acl_fetch_auth,   acl_match_str   },
      { "auth_md5",   acl_parse_str,   acl_fetch_auth,   acl_match_md5   },
      { NULL, NULL, NULL, NULL },
#endif
}};


__attribute__((constructor))
static void __http_protocol_init(void)
{
      acl_register_keywords(&acl_kws);
}


/*
 * Local variables:
 *  c-indent-level: 8
 *  c-basic-offset: 8
 * End:
 */

Generated by  Doxygen 1.6.0   Back to index